Difference between revisions of "GAMMA-BUTYROBETAINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite HOMOGENTISATE == * common-name: ** homogentisate * smiles: ** c1(c(=cc(=c(c=1)o)cc([o-])=o)o) * inchi-key: ** igmnyecmumzddf-uhfffaoysa-m...") |
(Created page with "Category:metabolite == Metabolite GAMMA-BUTYROBETAINE == * common-name: ** γ-butyrobetaine * smiles: ** c[n+](cccc([o-])=o)(c)c * inchi-key: ** jhpnvniexxlntr-uhfffa...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite GAMMA-BUTYROBETAINE == |
* common-name: | * common-name: | ||
− | ** | + | ** γ-butyrobetaine |
* smiles: | * smiles: | ||
− | ** | + | ** c[n+](cccc([o-])=o)(c)c |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** jhpnvniexxlntr-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 145.201 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[1.14.11.1-RXN]] |
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=γ-butyrobetaine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=jhpnvniexxlntr-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=145.201}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite GAMMA-BUTYROBETAINE
- common-name:
- γ-butyrobetaine
- smiles:
- c[n+](cccc([o-])=o)(c)c
- inchi-key:
- jhpnvniexxlntr-uhfffaoysa-n
- molecular-weight:
- 145.201