Difference between revisions of "GAMMA-LINOLENOYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ALPHA-GLUCOSE == * common-name: ** α-d-glucopyranose * smiles: ** c(o)c1(oc(c(c(c1o)o)o)o) * inchi-key: ** wqzgkkkjijffok-dvkngefbs...") |
(Created page with "Category:metabolite == Metabolite GAMMA-LINOLENOYL-COA == * common-name: ** γ-linolenoyl-coa * smiles: ** cccccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o...") |
||
| (5 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite GAMMA-LINOLENOYL-COA == |
* common-name: | * common-name: | ||
| − | ** & | + | ** γ-linolenoyl-coa |
* smiles: | * smiles: | ||
| − | ** c(o) | + | ** cccccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xzqyptbyqyzgru-fhdveodpsa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 1023.921 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-12777]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[1.14.19.3-RXN]] |
| − | + | * [[RXN-16043]] | |
| − | |||
| − | * [[RXN- | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=& | + | {{#set: common-name=γ-linolenoyl-coa}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xzqyptbyqyzgru-fhdveodpsa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=1023.921}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite GAMMA-LINOLENOYL-COA
- common-name:
- γ-linolenoyl-coa
- smiles:
- cccccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- xzqyptbyqyzgru-fhdveodpsa-j
- molecular-weight:
- 1023.921
