Difference between revisions of "GAMMA-LINOLENOYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17900 RXN-17900] == * direction: ** left-to-right * common-name: ** imidazoleglycerol-phosphate...")
(Created page with "Category:metabolite == Metabolite GAMMA-LINOLENOYL-COA == * common-name: ** γ-linolenoyl-coa * smiles: ** cccccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17900 RXN-17900] ==
+
== Metabolite GAMMA-LINOLENOYL-COA ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** imidazoleglycerol-phosphate synthase
+
** γ-linolenoyl-coa
−
== Reaction formula ==
+
* smiles:
−
* 1 [[AMMONIUM]][c] '''+''' 1 [[PHOSPHORIBULOSYL-FORMIMINO-AICAR-P]][c] '''=>''' 1 [[AICAR]][c] '''+''' 1 [[D-ERYTHRO-IMIDAZOLE-GLYCEROL-P]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[WATER]][c]
+
** cccccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
* Gene: [[SJ19186]]
+
** xzqyptbyqyzgru-fhdveodpsa-j
−
** Category: [[annotation]]
+
* molecular-weight:
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
** 1023.921
−
* Gene: [[SJ12953]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[annotation]]
+
* [[RXN-12777]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) ==
+
* [[1.14.19.3-RXN]]
−
== Reconstruction information  ==
+
* [[RXN-16043]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
== External links  ==
+
{{#set: common-name=γ-linolenoyl-coa}}
−
* RHEA:
+
{{#set: inchi-key=inchikey=xzqyptbyqyzgru-fhdveodpsa-j}}
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=45185 45185]
+
{{#set: molecular-weight=1023.921}}
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=imidazoleglycerol-phosphate synthase}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite GAMMA-LINOLENOYL-COA

  • common-name:
    • γ-linolenoyl-coa
  • smiles:
    • cccccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • xzqyptbyqyzgru-fhdveodpsa-j
  • molecular-weight:
    • 1023.921

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=GAMMA-LINOLENOYL-COA&oldid=139668"