Difference between revisions of "GAP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite LIPOYL-AMP == * common-name: ** lipoyl-adenylate * smiles: ** c1(ssc(c1)ccccc(=o)op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)o)o))([o-])=...")
(Created page with "Category:metabolite == Metabolite GAP == * common-name: ** d-glyceraldehyde 3-phosphate * smiles: ** [ch](=o)c(o)cop(=o)([o-])[o-] * inchi-key: ** lxjxrirhzlfyrp-vkhmyheas...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite LIPOYL-AMP ==
+
== Metabolite GAP ==
 
* common-name:
 
* common-name:
** lipoyl-adenylate
+
** d-glyceraldehyde 3-phosphate
 
* smiles:
 
* smiles:
** c1(ssc(c1)ccccc(=o)op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)o)o))([o-])=o)
+
** [ch](=o)c(o)cop(=o)([o-])[o-]
 
* inchi-key:
 
* inchi-key:
** qwegocjrzoksoe-aduakinbsa-m
+
** lxjxrirhzlfyrp-vkhmyheasa-l
 
* molecular-weight:
 
* molecular-weight:
** 534.518
+
** 168.043
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13039]]
+
* [[1TRANSKETO-RXN]]
* [[RXN-8655]]
+
* [[2TRANSKETO-RXN]]
 +
* [[DEHYDDEOXPHOSGALACT-ALDOL-RXN]]
 +
* [[DXS-RXN]]
 +
* [[F16ALDOLASE-RXN]]
 +
* [[FBA_]]
 +
* [[GAPDHSYNEC-RXN]]
 +
* [[GAPDH_]]
 +
* [[GAPOXNPHOSPHN-RXN]]
 +
* [[RXN-11322]]
 +
* [[RXN-12590]]
 +
* [[RXN-3443]]
 +
* [[RXN0-2381]]
 +
* [[TRANSALDOL-RXN]]
 +
* [[TRIOSEPISOMERIZATION-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8654]]
+
* [[1TRANSKETO-RXN]]
 +
* [[2TRANSKETO-RXN]]
 +
* [[DEHYDDEOXPHOSGALACT-ALDOL-RXN]]
 +
* [[F16ALDOLASE-RXN]]
 +
* [[FBA_]]
 +
* [[GAPDHSYNEC-RXN]]
 +
* [[GAPDH_]]
 +
* [[GAPOXNPHOSPHN-RXN]]
 +
* [[KDPGALDOL-RXN]]
 +
* [[RXN0-2381]]
 +
* [[TAGAALDOL-RXN]]
 +
* [[TRANSALDOL-RXN]]
 +
* [[TRIOKINASE-RXN]]
 +
* [[TRIOSEPISOMERIZATION-RXN]]
 +
* [[TRYPSYN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=lipoyl-adenylate}}
+
{{#set: common-name=d-glyceraldehyde 3-phosphate}}
{{#set: inchi-key=inchikey=qwegocjrzoksoe-aduakinbsa-m}}
+
{{#set: inchi-key=inchikey=lxjxrirhzlfyrp-vkhmyheasa-l}}
{{#set: molecular-weight=534.518}}
+
{{#set: molecular-weight=168.043}}

Latest revision as of 11:12, 18 March 2021