Difference between revisions of "GAP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite LIPOYL-AMP == * common-name: ** lipoyl-adenylate * smiles: ** c1(ssc(c1)ccccc(=o)op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)o)o))([o-])=...") |
(Created page with "Category:metabolite == Metabolite CPD-7003 == * common-name: ** tetrahydrogeranylgeranyl diphosphate * smiles: ** cc(=cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-7003 == |
* common-name: | * common-name: | ||
− | ** | + | ** tetrahydrogeranylgeranyl diphosphate |
* smiles: | * smiles: | ||
− | ** | + | ** cc(=cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** vzbgwadxujsbti-pyddkjgssa-k |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 451.456 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-7659]] |
− | * [[RXN- | + | * [[RXN-7660]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-7659]] |
+ | * [[RXN-7660]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=tetrahydrogeranylgeranyl diphosphate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vzbgwadxujsbti-pyddkjgssa-k}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=451.456}} |
Revision as of 15:26, 5 January 2021
Contents
Metabolite CPD-7003
- common-name:
- tetrahydrogeranylgeranyl diphosphate
- smiles:
- cc(=cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c
- inchi-key:
- vzbgwadxujsbti-pyddkjgssa-k
- molecular-weight:
- 451.456