Difference between revisions of "GAP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ALPHA-D-GALACTOSYL-ETCETERA-GLUCOSAMINYL == * common-name: ** an α-d-galactosyl-(1,3)-β-d-galactosyl-(1,4)-n-acetyl-d-glucosam...") |
(Created page with "Category:metabolite == Metabolite LIPOYL-AMP == * common-name: ** lipoyl-adenylate * smiles: ** c1(ssc(c1)ccccc(=o)op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)o)o))([o-])=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite LIPOYL-AMP == |
* common-name: | * common-name: | ||
| − | ** | + | ** lipoyl-adenylate |
| + | * smiles: | ||
| + | ** c1(ssc(c1)ccccc(=o)op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)o)o))([o-])=o) | ||
| + | * inchi-key: | ||
| + | ** qwegocjrzoksoe-aduakinbsa-m | ||
| + | * molecular-weight: | ||
| + | ** 534.518 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-13039]] | ||
| + | * [[RXN-8655]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-8654]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=lipoyl-adenylate}} |
| + | {{#set: inchi-key=inchikey=qwegocjrzoksoe-aduakinbsa-m}} | ||
| + | {{#set: molecular-weight=534.518}} | ||
Revision as of 18:53, 14 January 2021
Contents
Metabolite LIPOYL-AMP
- common-name:
- lipoyl-adenylate
- smiles:
- c1(ssc(c1)ccccc(=o)op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)o)o))([o-])=o)
- inchi-key:
- qwegocjrzoksoe-aduakinbsa-m
- molecular-weight:
- 534.518
