Difference between revisions of "GDP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3710 == * common-name: ** cytidine 2'-monophosphate * smiles: ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)op([o-])([o-])=o)o))o * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite 3-oxo-D5-steroids == * common-name: ** a 3-oxo-δ5-steroid == Reaction(s) known to consume the compound == * 1.1.1.145-RXN == Re...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-oxo-D5-steroids == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 3-oxo-δ5-steroid |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[1.1.1.145-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[1.1.1.145-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 3-oxo-δ5-steroid}} |
| − | |||
| − | |||
Revision as of 11:17, 15 January 2021
Contents
Metabolite 3-oxo-D5-steroids
- common-name:
- a 3-oxo-δ5-steroid
