Difference between revisions of "GDP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-oxo-D5-steroids == * common-name: ** a 3-oxo-δ5-steroid == Reaction(s) known to consume the compound == * 1.1.1.145-RXN == Re...") |
(Created page with "Category:metabolite == Metabolite CPD-13559 == * common-name: ** α-d-mannopyranose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o)o1) * inchi-key: ** wqzgkkkjijffok-pqmkyfcfsa-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-13559 == |
* common-name: | * common-name: | ||
| − | ** | + | ** α-d-mannopyranose |
| + | * smiles: | ||
| + | ** c(o)c1(c(o)c(o)c(o)c(o)o1) | ||
| + | * inchi-key: | ||
| + | ** wqzgkkkjijffok-pqmkyfcfsa-n | ||
| + | * molecular-weight: | ||
| + | ** 180.157 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[3.2.1.24-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=α-d-mannopyranose}} |
| + | {{#set: inchi-key=inchikey=wqzgkkkjijffok-pqmkyfcfsa-n}} | ||
| + | {{#set: molecular-weight=180.157}} | ||
Revision as of 08:28, 15 March 2021
Contents
Metabolite CPD-13559
- common-name:
- α-d-mannopyranose
- smiles:
- c(o)c1(c(o)c(o)c(o)c(o)o1)
- inchi-key:
- wqzgkkkjijffok-pqmkyfcfsa-n
- molecular-weight:
- 180.157
