Difference between revisions of "GDP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3710 == * common-name: ** cytidine 2'-monophosphate * smiles: ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)op([o-])([o-])=o)o))o * inchi-key:...")
(Created page with "Category:metabolite == Metabolite GDP == * common-name: ** gdp * smiles: ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** qgw...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-3710 ==
+
== Metabolite GDP ==
 
* common-name:
 
* common-name:
** cytidine 2'-monophosphate
+
** gdp
 
* smiles:
 
* smiles:
** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)op([o-])([o-])=o)o))o
+
** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
 
* inchi-key:
 
* inchi-key:
** yquakormlhpslz-xvfcmesisa-l
+
** qgwndrxfnxrzmb-uuokfmhzsa-k
 
* molecular-weight:
 
* molecular-weight:
** 321.183
+
** 440.179
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2.4.1.221-RXN]]
 +
* [[ATGD]]
 +
* [[DGOTO]]
 +
* [[GBDP]]
 +
* [[GDPKIN-RXN]]
 +
* [[GDPPYPHOSKIN-RXN]]
 +
* [[GDPREDUCT-RXN]]
 +
* [[GTPOP]]
 +
* [[GUANOSINE-DIPHOSPHATASE-RXN]]
 +
* [[MANNPGUANYLTRANGDP-RXN]]
 +
* [[RXN-12486]]
 +
* [[RXN-14117]]
 +
* [[RXN-15268]]
 +
* [[RXN0-748]]
 +
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 +
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12059]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[2.4.1.142-RXN]]
 +
* [[2.4.1.221-RXN]]
 +
* [[2.4.1.68-RXN]]
 +
* [[2.4.1.83-RXN]]
 +
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
 +
* [[AGPT]]
 +
* [[ALGINATE-SYNTHASE-RXN]]
 +
* [[FE2GTPabc]]
 +
* [[GALACTOSIDE-2-L-FUCOSYLTRANSFERASE-RXN]]
 +
* [[GALACTOSIDE-3-FUCOSYLTRANSFERASE-RXN]]
 +
* [[GBDP]]
 +
* [[GTCY]]
 +
* [[GTUP]]
 +
* [[GUANYL-KIN-RXN]]
 +
* [[MANNPGUANYLTRANGDP-RXN]]
 +
* [[PPGPPSYN-RXN]]
 +
* [[RXN-12486]]
 +
* [[RXN-15268]]
 +
* [[RXN-16602]]
 +
* [[RXN-5462]]
 +
* [[RXN-5463]]
 +
* [[RXN-5464]]
 +
* [[RXN-8988]]
 +
* [[RXN-9463]]
 +
* [[RXN0-5462]]
 +
* [[RXNQT-4141]]
 +
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 +
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 +
* [[URKI-RXN]]
 +
</div>
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cytidine 2'-monophosphate}}
+
{{#set: common-name=gdp}}
{{#set: inchi-key=inchikey=yquakormlhpslz-xvfcmesisa-l}}
+
{{#set: inchi-key=inchikey=qgwndrxfnxrzmb-uuokfmhzsa-k}}
{{#set: molecular-weight=321.183}}
+
{{#set: molecular-weight=440.179}}

Latest revision as of 11:15, 18 March 2021