Difference between revisions of "GDP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-Oxo-octanoyl-ACPs == * common-name: ** a 3-oxo-octanoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9524 == Reactio...") |
(Created page with "Category:metabolite == Metabolite CPD-13205 == * common-name: ** cellotetraose * smiles: ** c(c(c(c(c(co)o)oc1(c(c(c(c(co)o1)oc2(c(c(c(c(co)o2)oc3(c(c(c(c(co)o3)o)o)o))o)o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-13205 == |
* common-name: | * common-name: | ||
| − | ** | + | ** cellotetraose |
| + | * smiles: | ||
| + | ** c(c(c(c(c(co)o)oc1(c(c(c(c(co)o1)oc2(c(c(c(c(co)o2)oc3(c(c(c(c(co)o3)o)o)o))o)o))o)o))o)o)=o | ||
| + | * inchi-key: | ||
| + | ** uyqjcpnsavwafu-zeuiethysa-n | ||
| + | * molecular-weight: | ||
| + | ** 666.583 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-12305]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=cellotetraose}} |
| + | {{#set: inchi-key=inchikey=uyqjcpnsavwafu-zeuiethysa-n}} | ||
| + | {{#set: molecular-weight=666.583}} | ||
Revision as of 14:57, 5 January 2021
Contents
Metabolite CPD-13205
- common-name:
- cellotetraose
- smiles:
- c(c(c(c(c(co)o)oc1(c(c(c(c(co)o1)oc2(c(c(c(c(co)o2)oc3(c(c(c(c(co)o3)o)o)o))o)o))o)o))o)o)=o
- inchi-key:
- uyqjcpnsavwafu-zeuiethysa-n
- molecular-weight:
- 666.583
