Difference between revisions of "GDP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13205 == * common-name: ** cellotetraose * smiles: ** c(c(c(c(c(co)o)oc1(c(c(c(c(co)o1)oc2(c(c(c(c(co)o2)oc3(c(c(c(c(co)o3)o)o)o))o)o...")
(Created page with "Category:metabolite == Metabolite PROPANOL == * common-name: ** propan-1-ol * smiles: ** ccco * inchi-key: ** bdernnfjnopaec-uhfffaoysa-n * molecular-weight: ** 60.096 ==...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13205 ==
+
== Metabolite PROPANOL ==
 
* common-name:
 
* common-name:
** cellotetraose
+
** propan-1-ol
 
* smiles:
 
* smiles:
** c(c(c(c(c(co)o)oc1(c(c(c(c(co)o1)oc2(c(c(c(c(co)o2)oc3(c(c(c(c(co)o3)o)o)o))o)o))o)o))o)o)=o
+
** ccco
 
* inchi-key:
 
* inchi-key:
** uyqjcpnsavwafu-zeuiethysa-n
+
** bdernnfjnopaec-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 666.583
+
** 60.096
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12305]]
+
* [[RXN-13198]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-13198]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cellotetraose}}
+
{{#set: common-name=propan-1-ol}}
{{#set: inchi-key=inchikey=uyqjcpnsavwafu-zeuiethysa-n}}
+
{{#set: inchi-key=inchikey=bdernnfjnopaec-uhfffaoysa-n}}
{{#set: molecular-weight=666.583}}
+
{{#set: molecular-weight=60.096}}

Revision as of 15:28, 5 January 2021

Metabolite PROPANOL

  • common-name:
    • propan-1-ol
  • smiles:
    • ccco
  • inchi-key:
    • bdernnfjnopaec-uhfffaoysa-n
  • molecular-weight:
    • 60.096

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality