Difference between revisions of "GDP-D-GLUCOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10777 RXN-10777] == * direction: ** left-to-right * common-name: ** serotonin sulfotransferase...")
(Created page with "Category:metabolite == Metabolite GDP-D-GLUCOSE == * common-name: ** gdp-α-d-glucose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)op([o-])(=o)op([o-])(=o)occ2(oc(c(o)c(o)2)n...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10777 RXN-10777] ==
+
== Metabolite GDP-D-GLUCOSE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** serotonin sulfotransferase
+
** gdp-α-d-glucose
−
** aryl sulfotransferase
+
* smiles:
−
* ec-number:
+
** c(o)c1(c(o)c(o)c(o)c(o1)op([o-])(=o)op([o-])(=o)occ2(oc(c(o)c(o)2)n4(c=nc3(c(=o)nc(n)=nc=34))))
−
** [http://enzyme.expasy.org/EC/2.8.2.1 ec-2.8.2.1]
+
* inchi-key:
−
== Reaction formula ==
+
** mvmscbbuihutgj-lrjdveewsa-l
−
* 1 [[PAPS]][c] '''+''' 1 [[SEROTONIN]][c] '''=>''' 1 [[3-5-ADP]][c] '''+''' 1 [[CPD-11665]][c] '''+''' 1 [[PROTON]][c]
+
* molecular-weight:
−
== Gene(s) associated with this reaction  ==
+
** 603.329
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) known to consume the compound ==
−
* Gene: [[SJ00192]]
+
* [[RXN-12486]]
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-12486]]
−
* Gene: [[SJ07550]]
+
* [[RXN4FS-13]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: common-name=gdp-&alpha;-d-glucose}}
−
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=mvmscbbuihutgj-lrjdveewsa-l}}
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: molecular-weight=603.329}}
−
* Gene: [[SJ10094]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ06276]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
* Gene: [[SJ05841]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
* Gene: [[SJ01900]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ19194]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
</div>
 
−
== Pathway(s) ==
 
−
* [[PWY-6313]], serotonin degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6313 PWY-6313]
 
−
** '''6''' reactions found over '''7''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=aryl sulfotransferase|serotonin sulfotransferase}}
 
−
{{#set: ec-number=ec-2.8.2.1}}
 
−
{{#set: nb gene associated=7}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite GDP-D-GLUCOSE

  • common-name:
    • gdp-α-d-glucose
  • smiles:
    • c(o)c1(c(o)c(o)c(o)c(o1)op([o-])(=o)op([o-])(=o)occ2(oc(c(o)c(o)2)n4(c=nc3(c(=o)nc(n)=nc=34))))
  • inchi-key:
    • mvmscbbuihutgj-lrjdveewsa-l
  • molecular-weight:
    • 603.329

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=GDP-D-GLUCOSE&oldid=138604"