Difference between revisions of "GDP-D-GLUCOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9973 == * common-name: ** an [eif5a-precursor]-deoxyhypusine == Reaction(s) known to consume the compound == * DEOXYHYPUSINE-MONOOX...")
(Created page with "Category:metabolite == Metabolite GDP-D-GLUCOSE == * common-name: ** gdp-α-d-glucose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)op([o-])(=o)op([o-])(=o)occ2(oc(c(o)c(o)2)n...")
 
(6 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9973 ==
+
== Metabolite GDP-D-GLUCOSE ==
 
* common-name:
 
* common-name:
** an [eif5a-precursor]-deoxyhypusine
+
** gdp-α-d-glucose
 +
* smiles:
 +
** c(o)c1(c(o)c(o)c(o)c(o1)op([o-])(=o)op([o-])(=o)occ2(oc(c(o)c(o)2)n4(c=nc3(c(=o)nc(n)=nc=34))))
 +
* inchi-key:
 +
** mvmscbbuihutgj-lrjdveewsa-l
 +
* molecular-weight:
 +
** 603.329
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DEOXYHYPUSINE-MONOOXYGENASE-RXN]]
+
* [[RXN-12486]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.5.1.46-RXN]]
+
* [[RXN-12486]]
* [[RXN-13417]]
+
* [[RXN4FS-13]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an [eif5a-precursor]-deoxyhypusine}}
+
{{#set: common-name=gdp-α-d-glucose}}
 +
{{#set: inchi-key=inchikey=mvmscbbuihutgj-lrjdveewsa-l}}
 +
{{#set: molecular-weight=603.329}}

Latest revision as of 11:15, 18 March 2021

Metabolite GDP-D-GLUCOSE

  • common-name:
    • gdp-α-d-glucose
  • smiles:
    • c(o)c1(c(o)c(o)c(o)c(o1)op([o-])(=o)op([o-])(=o)occ2(oc(c(o)c(o)2)n4(c=nc3(c(=o)nc(n)=nc=34))))
  • inchi-key:
    • mvmscbbuihutgj-lrjdveewsa-l
  • molecular-weight:
    • 603.329

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality