Difference between revisions of "GDP-D-GLUCOSE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-Oxo-octanoyl-ACPs == * common-name: ** a 3-oxo-octanoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9524 == Reactio...") |
(Created page with "Category:metabolite == Metabolite GDP-D-GLUCOSE == * common-name: ** gdp-α-d-glucose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)op([o-])(=o)op([o-])(=o)occ2(oc(c(o)c(o)2)n...") |
||
(4 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite GDP-D-GLUCOSE == |
* common-name: | * common-name: | ||
− | ** | + | ** gdp-α-d-glucose |
+ | * smiles: | ||
+ | ** c(o)c1(c(o)c(o)c(o)c(o1)op([o-])(=o)op([o-])(=o)occ2(oc(c(o)c(o)2)n4(c=nc3(c(=o)nc(n)=nc=34)))) | ||
+ | * inchi-key: | ||
+ | ** mvmscbbuihutgj-lrjdveewsa-l | ||
+ | * molecular-weight: | ||
+ | ** 603.329 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-12486]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-12486]] |
− | * [[ | + | * [[RXN4FS-13]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=gdp-α-d-glucose}} |
+ | {{#set: inchi-key=inchikey=mvmscbbuihutgj-lrjdveewsa-l}} | ||
+ | {{#set: molecular-weight=603.329}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite GDP-D-GLUCOSE
- common-name:
- gdp-α-d-glucose
- smiles:
- c(o)c1(c(o)c(o)c(o)c(o1)op([o-])(=o)op([o-])(=o)occ2(oc(c(o)c(o)2)n4(c=nc3(c(=o)nc(n)=nc=34))))
- inchi-key:
- mvmscbbuihutgj-lrjdveewsa-l
- molecular-weight:
- 603.329