Difference between revisions of "GDP-L-GALACTOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ02723 == * transcription-direction: ** negative * right-end-position: ** 510103 * left-end-position: ** 508438 * centisome-position: ** 95.15590...")
(Created page with "Category:metabolite == Metabolite GDP-L-GALACTOSE == * common-name: ** gdp-β-l-galactose * smiles: ** c(c3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))op(op(oc4(c(c(c...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ02723 ==
+
== Metabolite GDP-L-GALACTOSE ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** gdp-β-l-galactose
−
* right-end-position:
+
* smiles:
−
** 510103
+
** c(c3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))op(op(oc4(c(c(c(c(o4)co)o)o)o))([o-])=o)([o-])=o
−
* left-end-position:
+
* inchi-key:
−
** 508438
+
** mvmscbbuihutgj-jgqubwhwsa-l
−
* centisome-position:
+
* molecular-weight:
−
** 95.15590   
+
** 603.329
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-1882]]
−
== Reaction(s) associated ==
+
* [[RXN4FS-12]]
−
* [[RETINOL-DEHYDROGENASE-RXN]]
+
* [[RXN4FS-13]]
−
** Category: [[annotation]]
+
* [[RXNQT-4141]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* [[RXN-10841]]
+
* [[RXN-1882]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=gdp-β-l-galactose}}
−
* [[RXN-12581]]
+
{{#set: inchi-key=inchikey=mvmscbbuihutgj-jgqubwhwsa-l}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=603.329}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-6857]]
 
−
** '''3''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-6861]]
 
−
** '''1''' reactions found over '''12''' reactions in the full pathway
 
−
* [[PWY-6872]]
 
−
** '''1''' reactions found over '''4''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=510103}}
 
−
{{#set: left-end-position=508438}}
 
−
{{#set: centisome-position=95.15590    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=3}}
 
−
{{#set: nb pathway associated=3}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite GDP-L-GALACTOSE

  • common-name:
    • gdp-β-l-galactose
  • smiles:
    • c(c3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))op(op(oc4(c(c(c(c(o4)co)o)o)o))([o-])=o)([o-])=o
  • inchi-key:
    • mvmscbbuihutgj-jgqubwhwsa-l
  • molecular-weight:
    • 603.329

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=GDP-L-GALACTOSE&oldid=138544"