Difference between revisions of "GDP-L-GALACTOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11919 RXN-11919] == * direction: ** left-to-right * common-name: ** (2e)-5-methylhexa-2,4-dieno...")
 
(Created page with "Category:metabolite == Metabolite GDP-L-GALACTOSE == * common-name: ** gdp-β-l-galactose * smiles: ** c(c3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))op(op(oc4(c(c(c...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11919 RXN-11919] ==
+
== Metabolite GDP-L-GALACTOSE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** (2e)-5-methylhexa-2,4-dienoyl-coa hydratase
+
** gdp-β-l-galactose
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/4.2.1 ec-4.2.1]
+
** c(c3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))op(op(oc4(c(c(c(c(o4)co)o)o)o))([o-])=o)([o-])=o
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-12904]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-12905]][c]
+
** mvmscbbuihutgj-jgqubwhwsa-l
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ03913]]
+
** 603.329
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-1882]]
−
== Pathway(s) ==
+
* [[RXN4FS-12]]
−
* [[PWY-6672]], cis-genanyl-CoA degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6672 PWY-6672]
+
* [[RXN4FS-13]]
−
** '''4''' reactions found over '''9''' reactions in the full pathway
+
* [[RXNQT-4141]]
−
== Reconstruction information  ==
+
== Reaction(s) known to produce the compound ==
−
* category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-1882]]
−
== External links  ==
+
== Reaction(s) of unknown directionality ==
−
* LIGAND-RXN:
+
{{#set: common-name=gdp-β-l-galactose}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R08093 R08093]
+
{{#set: inchi-key=inchikey=mvmscbbuihutgj-jgqubwhwsa-l}}
−
{{#set: direction=left-to-right}}
+
{{#set: molecular-weight=603.329}}
−
{{#set: common-name=(2e)-5-methylhexa-2,4-dienoyl-coa hydratase}}
 
−
{{#set: ec-number=ec-4.2.1}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_arabidopsis_thaliana}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite GDP-L-GALACTOSE

  • common-name:
    • gdp-β-l-galactose
  • smiles:
    • c(c3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))op(op(oc4(c(c(c(c(o4)co)o)o)o))([o-])=o)([o-])=o
  • inchi-key:
    • mvmscbbuihutgj-jgqubwhwsa-l
  • molecular-weight:
    • 603.329

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=GDP-L-GALACTOSE&oldid=138544"