Difference between revisions of "GDP-L-GALACTOSE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7496 == * common-name: ** prolycopene * smiles: ** cc(=cccc(=cc=cc(c)=cc=cc(=cc=cc=c(c=cc=c(c)c=cc=c(ccc=c(c)c)c)c)c)c)c * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite CPD-671 == * common-name: ** a 5-formiminotetrahydrofolate == Reaction(s) known to consume the compound == == Reaction(s) known to produc...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-671 == |
* common-name: | * common-name: | ||
− | ** | + | ** a 5-formiminotetrahydrofolate |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[GLUTAMATE-FORMIMINOTRANSFERASE-RXN]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a 5-formiminotetrahydrofolate}} |
− | |||
− |
Revision as of 13:11, 14 January 2021
Contents
Metabolite CPD-671
- common-name:
- a 5-formiminotetrahydrofolate