Difference between revisions of "GDP-MANNOSE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite UTP == * common-name: ** utp * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite GDP-MANNOSE == * common-name: ** gdp-α-d-mannose * smiles: ** c(op([o-])(=o)op([o-])(=o)oc1(oc(c(o)c(o)c(o)1)co))c2(c(o)c(o)c(o2)n4...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite GDP-MANNOSE == |
* common-name: | * common-name: | ||
| − | ** | + | ** gdp-α-d-mannose |
* smiles: | * smiles: | ||
| − | ** c(op | + | ** c(op([o-])(=o)op([o-])(=o)oc1(oc(c(o)c(o)c(o)1)co))c2(c(o)c(o)c(o2)n4(c=nc3(c(=o)nc(n)=nc=34))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** mvmscbbuihutgj-gdjbgnaasa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 603.329 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[2. | + | * [[2.4.1.142-RXN]] |
| − | * [[2. | + | * [[2.4.1.83-RXN]] |
| − | * [[ | + | * [[GDP-MANNOSE-6-DEHYDROGENASE-RXN]] |
| − | + | * [[GDPMANDEHYDRA-RXN]] | |
| − | + | * [[MANNPGUANYLTRANGDP-RXN]] | |
| − | * [[ | + | * [[RXN-16602]] |
| − | * [[ | + | * [[RXN-1882]] |
| − | + | * [[RXN-5462]] | |
| − | * [[RXN- | + | * [[RXN-5463]] |
| − | * [[RXN- | + | * [[RXN-5464]] |
| − | * [[RXN- | ||
| − | * [[RXN- | ||
| − | * [[RXN- | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[MANNPGUANYLTRANGDP-RXN]] |
| − | + | * [[RXN-1882]] | |
| − | + | * [[RXN4FS-12]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | * [[ | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=gdp-α-d-mannose}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mvmscbbuihutgj-gdjbgnaasa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=603.329}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite GDP-MANNOSE
- common-name:
- gdp-α-d-mannose
- smiles:
- c(op([o-])(=o)op([o-])(=o)oc1(oc(c(o)c(o)c(o)1)co))c2(c(o)c(o)c(o2)n4(c=nc3(c(=o)nc(n)=nc=34)))
- inchi-key:
- mvmscbbuihutgj-gdjbgnaasa-l
- molecular-weight:
- 603.329
Reaction(s) known to consume the compound
- 2.4.1.142-RXN
- 2.4.1.83-RXN
- GDP-MANNOSE-6-DEHYDROGENASE-RXN
- GDPMANDEHYDRA-RXN
- MANNPGUANYLTRANGDP-RXN
- RXN-16602
- RXN-1882
- RXN-5462
- RXN-5463
- RXN-5464
