Difference between revisions of "GDP-MANNOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-1828 == * common-name: ** gdp-α-d-mannuronate * smiles: ** c(op(=o)([o-])op(=o)([o-])oc1(oc(c(=o)[o-])c(o)c(o)c(o)1))c2(oc(c(o)...")
(Created page with "Category:metabolite == Metabolite UDP-sugar == * common-name: ** a udp-sugar == Reaction(s) known to consume the compound == * 2.7.7.64-RXN == Reaction(s) known to pro...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-1828 ==
+
== Metabolite UDP-sugar ==
 
* common-name:
 
* common-name:
** gdp-α-d-mannuronate
+
** a udp-sugar
* smiles:
 
** c(op(=o)([o-])op(=o)([o-])oc1(oc(c(=o)[o-])c(o)c(o)c(o)1))c2(oc(c(o)c(o)2)n4(c=nc3(c(=o)nc(n)=nc=34)))
 
* inchi-key:
 
** dnbsdudynpjvcn-zxtxfpbhsa-k
 
* molecular-weight:
 
** 616.305
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ALGINATE-SYNTHASE-RXN]]
+
* [[2.7.7.64-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GDP-MANNOSE-6-DEHYDROGENASE-RXN]]
+
* [[2.7.7.64-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=gdp-α-d-mannuronate}}
+
{{#set: common-name=a udp-sugar}}
{{#set: inchi-key=inchikey=dnbsdudynpjvcn-zxtxfpbhsa-k}}
 
{{#set: molecular-weight=616.305}}
 

Revision as of 13:07, 14 January 2021

Metabolite UDP-sugar

  • common-name:
    • a udp-sugar

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality