Difference between revisions of "GDP-MANNOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ00818 == * transcription-direction: ** positive * right-end-position: ** 321352 * left-end-position: ** 288338 * centisome-position: ** 51.591557...")
(Created page with "Category:metabolite == Metabolite GDP-MANNOSE == * common-name: ** gdp-α-d-mannose * smiles: ** c(op([o-])(=o)op([o-])(=o)oc1(oc(c(o)c(o)c(o)1)co))c2(c(o)c(o)c(o2)n4...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ00818 ==
+
== Metabolite GDP-MANNOSE ==
* transcription-direction:
+
* common-name:
** positive
+
** gdp-α-d-mannose
* right-end-position:
+
* smiles:
** 321352
+
** c(op([o-])(=o)op([o-])(=o)oc1(oc(c(o)c(o)c(o)1)co))c2(c(o)c(o)c(o2)n4(c=nc3(c(=o)nc(n)=nc=34)))
* left-end-position:
+
* inchi-key:
** 288338
+
** mvmscbbuihutgj-gdjbgnaasa-l
* centisome-position:
+
* molecular-weight:
** 51.591557   
+
** 603.329
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[2.4.1.142-RXN]]
== Reaction(s) associated ==
+
* [[2.4.1.83-RXN]]
* [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
+
* [[GDP-MANNOSE-6-DEHYDROGENASE-RXN]]
** Category: [[annotation]]
+
* [[GDPMANDEHYDRA-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[MANNPGUANYLTRANGDP-RXN]]
** Category: [[orthology]]
+
* [[RXN-16602]]
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-1882]]
{{#set: transcription-direction=positive}}
+
* [[RXN-5462]]
{{#set: right-end-position=321352}}
+
* [[RXN-5463]]
{{#set: left-end-position=288338}}
+
* [[RXN-5464]]
{{#set: centisome-position=51.591557    }}
+
== Reaction(s) known to produce the compound ==
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* [[MANNPGUANYLTRANGDP-RXN]]
{{#set: nb reaction associated=1}}
+
* [[RXN-1882]]
 +
* [[RXN4FS-12]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=gdp-α-d-mannose}}
 +
{{#set: inchi-key=inchikey=mvmscbbuihutgj-gdjbgnaasa-l}}
 +
{{#set: molecular-weight=603.329}}

Latest revision as of 11:11, 18 March 2021

Metabolite GDP-MANNOSE

  • common-name:
    • gdp-α-d-mannose
  • smiles:
    • c(op([o-])(=o)op([o-])(=o)oc1(oc(c(o)c(o)c(o)1)co))c2(c(o)c(o)c(o2)n4(c=nc3(c(=o)nc(n)=nc=34)))
  • inchi-key:
    • mvmscbbuihutgj-gdjbgnaasa-l
  • molecular-weight:
    • 603.329

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality