Difference between revisions of "GDP-TP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite a-pyruvate-dehydrogenase-E2-protein-Nsup == * common-name: ** a [pyruvate dehydrogenase e2 protein] n6-octanoyl-l-lysine == Reaction(s) k...") |
(Created page with "Category:metabolite == Metabolite GDP-TP == * common-name: ** pppgpp * smiles: ** c(op([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])c1(oc(c(o)c(op([o-])(=o)op(o)([o-])=o)1)n3(c=n...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite GDP-TP == |
* common-name: | * common-name: | ||
| − | ** | + | ** pppgpp |
| + | * smiles: | ||
| + | ** c(op([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])c1(oc(c(o)c(op([o-])(=o)op(o)([o-])=o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) | ||
| + | * inchi-key: | ||
| + | ** kcpmacxzaitqax-uuokfmhzsa-h | ||
| + | * molecular-weight: | ||
| + | ** 677.095 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-6427]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[GTPPYPHOSKIN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=pppgpp}} |
| + | {{#set: inchi-key=inchikey=kcpmacxzaitqax-uuokfmhzsa-h}} | ||
| + | {{#set: molecular-weight=677.095}} | ||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite GDP-TP
- common-name:
- pppgpp
- smiles:
- c(op([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])c1(oc(c(o)c(op([o-])(=o)op(o)([o-])=o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
- inchi-key:
- kcpmacxzaitqax-uuokfmhzsa-h
- molecular-weight:
- 677.095
