Difference between revisions of "GDP-TP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ17268 == * transcription-direction: ** positive * right-end-position: ** 144617 * left-end-position: ** 140756 * centisome-position: ** 52.858955...")
(Created page with "Category:metabolite == Metabolite GDP-TP == * common-name: ** pppgpp * smiles: ** c(op([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])c1(oc(c(o)c(op([o-])(=o)op(o)([o-])=o)1)n3(c=n...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ17268 ==
+
== Metabolite GDP-TP ==
* transcription-direction:
+
* common-name:
** positive
+
** pppgpp
* right-end-position:
+
* smiles:
** 144617
+
** c(op([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])c1(oc(c(o)c(op([o-])(=o)op(o)([o-])=o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
* left-end-position:
+
* inchi-key:
** 140756
+
** kcpmacxzaitqax-uuokfmhzsa-h
* centisome-position:
+
* molecular-weight:
** 52.858955   
+
** 677.095
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN0-6427]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[DIHYDLIPACETRANS-RXN]]
+
* [[GTPPYPHOSKIN-RXN]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=pppgpp}}
* [[RXN0-1133]]
+
{{#set: inchi-key=inchikey=kcpmacxzaitqax-uuokfmhzsa-h}}
** Category: [[annotation]]
+
{{#set: molecular-weight=677.095}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== Pathway(s) associated ==
 
* [[PYRUVDEHYD-PWY]]
 
** '''3''' reactions found over '''3''' reactions in the full pathway
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=144617}}
 
{{#set: left-end-position=140756}}
 
{{#set: centisome-position=52.858955    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=2}}
 
{{#set: nb pathway associated=1}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite GDP-TP

  • common-name:
    • pppgpp
  • smiles:
    • c(op([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])c1(oc(c(o)c(op([o-])(=o)op(o)([o-])=o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
  • inchi-key:
    • kcpmacxzaitqax-uuokfmhzsa-h
  • molecular-weight:
    • 677.095

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality