Difference between revisions of "GDP-TP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Charged-MET-tRNAs == * common-name: ** an l-methionyl-[elongator trnamet] == Reaction(s) known to consume the compound == == Reaction(s)...")
(Created page with "Category:metabolite == Metabolite GDP-TP == * common-name: ** pppgpp * smiles: ** c(op([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])c1(oc(c(o)c(op([o-])(=o)op(o)([o-])=o)1)n3(c=n...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Charged-MET-tRNAs ==
+
== Metabolite GDP-TP ==
 
* common-name:
 
* common-name:
** an l-methionyl-[elongator trnamet]
+
** pppgpp
 +
* smiles:
 +
** c(op([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])c1(oc(c(o)c(op([o-])(=o)op(o)([o-])=o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
 +
* inchi-key:
 +
** kcpmacxzaitqax-uuokfmhzsa-h
 +
* molecular-weight:
 +
** 677.095
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN0-6427]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[METHIONINE--TRNA-LIGASE-RXN]]
+
* [[GTPPYPHOSKIN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an l-methionyl-[elongator trnamet]}}
+
{{#set: common-name=pppgpp}}
 +
{{#set: inchi-key=inchikey=kcpmacxzaitqax-uuokfmhzsa-h}}
 +
{{#set: molecular-weight=677.095}}

Latest revision as of 11:11, 18 March 2021

Metabolite GDP-TP

  • common-name:
    • pppgpp
  • smiles:
    • c(op([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])c1(oc(c(o)c(op([o-])(=o)op(o)([o-])=o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
  • inchi-key:
    • kcpmacxzaitqax-uuokfmhzsa-h
  • molecular-weight:
    • 677.095

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality