Difference between revisions of "GDP-TP"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ21995 == * transcription-direction: ** negative * right-end-position: ** 168394 * left-end-position: ** 167741 * centisome-position: ** 91.82835...") |
(Created page with "Category:metabolite == Metabolite GDP-TP == * common-name: ** pppgpp * smiles: ** c(op([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])c1(oc(c(o)c(op([o-])(=o)op(o)([o-])=o)1)n3(c=n...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite GDP-TP == |
− | * | + | * common-name: |
− | ** | + | ** pppgpp |
− | * | + | * smiles: |
− | ** | + | ** c(op([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])c1(oc(c(o)c(op([o-])(=o)op(o)([o-])=o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) |
− | * | + | * inchi-key: |
− | ** | + | ** kcpmacxzaitqax-uuokfmhzsa-h |
− | * | + | * molecular-weight: |
− | ** | + | ** 677.095 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN0-6427]] |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | * [[ | + | * [[GTPPYPHOSKIN-RXN]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=pppgpp}} | |
− | {{#set: | + | {{#set: inchi-key=inchikey=kcpmacxzaitqax-uuokfmhzsa-h}} |
− | {{#set: | + | {{#set: molecular-weight=677.095}} |
− | |||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite GDP-TP
- common-name:
- pppgpp
- smiles:
- c(op([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])c1(oc(c(o)c(op([o-])(=o)op(o)([o-])=o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
- inchi-key:
- kcpmacxzaitqax-uuokfmhzsa-h
- molecular-weight:
- 677.095