Difference between revisions of "GDP-TP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ18962 == * transcription-direction: ** positive * right-end-position: ** 360074 * left-end-position: ** 332769 * centisome-position: ** 51.955135...")
(Created page with "Category:metabolite == Metabolite NICOTINATE_NUCLEOTIDE == * common-name: ** β-nicotinate d-ribonucleotide * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c=cc=...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ18962 ==
+
== Metabolite NICOTINATE_NUCLEOTIDE ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** β-nicotinate d-ribonucleotide
−
* right-end-position:
+
* smiles:
−
** 360074
+
** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)[o-])c=2))
−
* left-end-position:
+
* inchi-key:
−
** 332769
+
** jouiqrnqjgxqdc-zyuzmqfosa-l
−
* centisome-position:
+
* molecular-weight:
−
** 51.955135   
+
** 333.191
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[NICONUCADENYLYLTRAN-RXN]]
−
== Reaction(s) associated ==
+
* [[RXN-14227]]
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) known to produce the compound ==
−
* [[3.6.3.8-RXN]]
+
* [[NICOTINATEPRIBOSYLTRANS-RXN]]
−
** Category: [[annotation]]
+
* [[QUINOPRIBOTRANS-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-8443]]
−
* [[ATPASE-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=&beta;-nicotinate d-ribonucleotide}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=jouiqrnqjgxqdc-zyuzmqfosa-l}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=333.191}}
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12195]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12196]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN0-5462]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[TRANS-RXN-193]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7210]]
 
−
** '''8''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-7198]]
 
−
** '''6''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-7184]]
 
−
** '''9''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-6545]]
 
−
** '''8''' reactions found over '''9''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=360074}}
 
−
{{#set: left-end-position=332769}}
 
−
{{#set: centisome-position=51.955135    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=7}}
 
−
{{#set: nb pathway associated=4}}
 

Revision as of 20:30, 18 December 2020

Metabolite NICOTINATE_NUCLEOTIDE

  • common-name:
    • β-nicotinate d-ribonucleotide
  • smiles:
    • c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)[o-])c=2))
  • inchi-key:
    • jouiqrnqjgxqdc-zyuzmqfosa-l
  • molecular-weight:
    • 333.191

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=GDP-TP&oldid=45795"