Difference between revisions of "GDPRHAMSYN-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11495 CPD-11495] == * common-name: ** (2-hydroxyphenyl)acetate * smiles: ** c(=o)([o-])cc1(...")
(Created page with "Category:pathway == Pathway ILEUSYN-PWY == * taxonomic-range: ** tax-2759 ** tax-2 * common-name: ** l-isoleucine biosynthesis i (from threonine) == Reaction(s) found == *...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11495 CPD-11495] ==
+
== Pathway ILEUSYN-PWY ==
 +
* taxonomic-range:
 +
** tax-2759
 +
** tax-2
 
* common-name:
 
* common-name:
** (2-hydroxyphenyl)acetate
+
** l-isoleucine biosynthesis i (from threonine)
* smiles:
+
== Reaction(s) found ==
** c(=o)([o-])cc1(=c(o)c=cc=c1)
+
* [[ACETOOHBUTREDUCTOISOM-RXN]]
* inchi-key:
+
* [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]]
** ccvyrrgzdbshfu-uhfffaoysa-m
+
* [[DIHYDROXYMETVALDEHYDRAT-RXN]]
* molecular-weight:
+
* [[RXN-15122]]
** 151.141
+
== Reaction(s) not found ==
== Reaction(s) known to consume the compound ==
+
* [NoneRXN-15121 RXN-15121]
== Reaction(s) known to produce the compound ==
+
* [NoneACETOOHBUTSYN-RXN ACETOOHBUTSYN-RXN]
* [[RXN-10815]]
+
* [NoneRXN-15123 RXN-15123]
== Reaction(s) of unknown directionality ==
+
{{#set: taxonomic-range=tax-2|tax-2759}}
{{#set: common-name=(2-hydroxyphenyl)acetate}}
+
{{#set: common-name=l-isoleucine biosynthesis i (from threonine)}}
{{#set: inchi-key=inchikey=ccvyrrgzdbshfu-uhfffaoysa-m}}
+
{{#set: nb reaction found=4}}
{{#set: molecular-weight=151.141}}
+
{{#set: completion rate=0.57}}
 +
{{#set: nb total reaction=7}}

Revision as of 20:16, 18 December 2020

Pathway ILEUSYN-PWY

  • taxonomic-range:
    • tax-2759
    • tax-2
  • common-name:
    • l-isoleucine biosynthesis i (from threonine)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-15121 RXN-15121]
  • [NoneACETOOHBUTSYN-RXN ACETOOHBUTSYN-RXN]
  • [NoneRXN-15123 RXN-15123]