Difference between revisions of "GERANYL-PP"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ18806 == * transcription-direction: ** negative * right-end-position: ** 94407 * left-end-position: ** 87277 * centisome-position: ** 37.03985...") |
(Created page with "Category:metabolite == Metabolite GERANYL-PP == * common-name: ** geranyl diphosphate * smiles: ** cc(=cccc(=ccop([o-])(op(=o)([o-])[o-])=o)c)c * inchi-key: ** gvvpgtzrzfn...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite GERANYL-PP == |
| − | * | + | * common-name: |
| − | ** | + | ** geranyl diphosphate |
| − | * | + | * smiles: |
| − | ** | + | ** cc(=cccc(=ccop([o-])(op(=o)([o-])[o-])=o)c)c |
| − | * | + | * inchi-key: |
| − | ** | + | ** gvvpgtzrzfnkds-jxmrogbwsa-k |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 311.188 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[FPPS]] |
| − | + | * [[FPPSYN-RXN]] | |
| − | * [[ | + | * [[GPPSYN-RXN]] |
| − | * | + | * [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | + | * [[GPPS]] | |
| − | * | + | * [[GPPSYN-RXN]] |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | == | + | {{#set: common-name=geranyl diphosphate}} |
| − | + | {{#set: inchi-key=inchikey=gvvpgtzrzfnkds-jxmrogbwsa-k}} | |
| − | + | {{#set: molecular-weight=311.188}} | |
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite GERANYL-PP
- common-name:
- geranyl diphosphate
- smiles:
- cc(=cccc(=ccop([o-])(op(=o)([o-])[o-])=o)c)c
- inchi-key:
- gvvpgtzrzfnkds-jxmrogbwsa-k
- molecular-weight:
- 311.188
