Difference between revisions of "GERANYL-PP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-Acylsphingosine == * common-name: ** a sphingosine ceramide == Reaction(s) known to consume the compound == * RXN-15211 == Reaction...") |
(Created page with "Category:metabolite == Metabolite GERANYL-PP == * common-name: ** geranyl diphosphate * smiles: ** cc(=cccc(=ccop([o-])(op(=o)([o-])[o-])=o)c)c * inchi-key: ** gvvpgtzrzfn...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite GERANYL-PP == |
* common-name: | * common-name: | ||
− | ** | + | ** geranyl diphosphate |
+ | * smiles: | ||
+ | ** cc(=cccc(=ccop([o-])(op(=o)([o-])[o-])=o)c)c | ||
+ | * inchi-key: | ||
+ | ** gvvpgtzrzfnkds-jxmrogbwsa-k | ||
+ | * molecular-weight: | ||
+ | ** 311.188 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[FPPS]] |
+ | * [[FPPSYN-RXN]] | ||
+ | * [[GPPSYN-RXN]] | ||
+ | * [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[GPPS]] |
− | * [[RXN | + | * [[GPPSYN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=geranyl diphosphate}} |
+ | {{#set: inchi-key=inchikey=gvvpgtzrzfnkds-jxmrogbwsa-k}} | ||
+ | {{#set: molecular-weight=311.188}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite GERANYL-PP
- common-name:
- geranyl diphosphate
- smiles:
- cc(=cccc(=ccop([o-])(op(=o)([o-])[o-])=o)c)c
- inchi-key:
- gvvpgtzrzfnkds-jxmrogbwsa-k
- molecular-weight:
- 311.188