Difference between revisions of "GERANYL-PP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ06121 == * transcription-direction: ** positive * right-end-position: ** 116824 * left-end-position: ** 80027 * centisome-position: ** 16.628712...")
 
(Created page with "Category:metabolite == Metabolite GERANYL-PP == * common-name: ** geranyl diphosphate * smiles: ** cc(=cccc(=ccop([o-])(op(=o)([o-])[o-])=o)c)c * inchi-key: ** gvvpgtzrzfn...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ06121 ==
+
== Metabolite GERANYL-PP ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** geranyl diphosphate
−
* right-end-position:
+
* smiles:
−
** 116824
+
** cc(=cccc(=ccop([o-])(op(=o)([o-])[o-])=o)c)c
−
* left-end-position:
+
* inchi-key:
−
** 80027
+
** gvvpgtzrzfnkds-jxmrogbwsa-k
−
* centisome-position:
+
* molecular-weight:
−
** 16.628712   
+
** 311.188
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[FPPS]]
−
== Reaction(s) associated ==
+
* [[FPPSYN-RXN]]
−
* [[BETA-UREIDOPROPIONASE-RXN]]
+
* [[GPPSYN-RXN]]
−
** Category: [[orthology]]
+
* [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]]
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[GPPS]]
−
* [[N-CARBAMOYLPUTRESCINE-AMIDASE-RXN]]
+
* [[GPPSYN-RXN]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=geranyl diphosphate}}
−
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=gvvpgtzrzfnkds-jxmrogbwsa-k}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=311.188}}
−
* [[RXN-11210]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-3982]]
 
−
** '''1''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-43]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
* [[ARGDEG-III-PWY]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-6430]]
 
−
** '''1''' reactions found over '''3''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=116824}}
 
−
{{#set: left-end-position=80027}}
 
−
{{#set: centisome-position=16.628712    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=3}}
 
−
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite GERANYL-PP

  • common-name:
    • geranyl diphosphate
  • smiles:
    • cc(=cccc(=ccop([o-])(op(=o)([o-])[o-])=o)c)c
  • inchi-key:
    • gvvpgtzrzfnkds-jxmrogbwsa-k
  • molecular-weight:
    • 311.188

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=GERANYL-PP&oldid=136910"