Difference between revisions of "GERANYL-PP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite N-Acylsphingosine == * common-name: ** a sphingosine ceramide == Reaction(s) known to consume the compound == * RXN-15211 == Reaction...")
(Created page with "Category:metabolite == Metabolite GERANYL-PP == * common-name: ** geranyl diphosphate * smiles: ** cc(=cccc(=ccop([o-])(op(=o)([o-])[o-])=o)c)c * inchi-key: ** gvvpgtzrzfn...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite N-Acylsphingosine ==
+
== Metabolite GERANYL-PP ==
 
* common-name:
 
* common-name:
** a sphingosine ceramide
+
** geranyl diphosphate
 +
* smiles:
 +
** cc(=cccc(=ccop([o-])(op(=o)([o-])[o-])=o)c)c
 +
* inchi-key:
 +
** gvvpgtzrzfnkds-jxmrogbwsa-k
 +
* molecular-weight:
 +
** 311.188
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15211]]
+
* [[FPPS]]
 +
* [[FPPSYN-RXN]]
 +
* [[GPPSYN-RXN]]
 +
* [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GLUCOSYLCERAMIDASE-RXN]]
+
* [[GPPS]]
* [[RXN-15212]]
+
* [[GPPSYN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a sphingosine ceramide}}
+
{{#set: common-name=geranyl diphosphate}}
 +
{{#set: inchi-key=inchikey=gvvpgtzrzfnkds-jxmrogbwsa-k}}
 +
{{#set: molecular-weight=311.188}}

Latest revision as of 11:11, 18 March 2021

Metabolite GERANYL-PP

  • common-name:
    • geranyl diphosphate
  • smiles:
    • cc(=cccc(=ccop([o-])(op(=o)([o-])[o-])=o)c)c
  • inchi-key:
    • gvvpgtzrzfnkds-jxmrogbwsa-k
  • molecular-weight:
    • 311.188

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality