Difference between revisions of "GERANYLGERANYL-PP"

Latest revision as of 11:15, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-9067 ==
+== Metabolite GERANYLGERANYL-PP ==
+* common-name:
+** geranylgeranyl diphosphate
 * smiles:
-** ccc5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)cccc(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4)=cc5=6)))=cc8(=c(c)c(c(c)=o)=c(n78)c=9))))))
+** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
-* common-name:
+* inchi-key:
-** bacteriochlorophyll a
+** oinneunvozhbox-qircyjposa-k
 * molecular-weight:
-** 910.51
+** 447.424
 == Reaction(s) known to consume the compound ==
-* [[RXN-8791]]
+* [[2.5.1.32-RXN]]
+* [[2.5.1.41-RXN]]
+* [[2.5.1.42-RXN]]
+* [[RXN-10625]]
+* [[RXN-11486]]
+* [[RXN-11488]]
+* [[RXN-13323]]
+* [[RXN-14929]]
+* [[RXN-17480]]
+* [[RXN-3701]]
+* [[RXN-7658]]
+* [[RXN-7663]]
+* [[RXN-7673]]
+* [[RXN-8788]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-17426]]
+* [[FARNESYLTRANSTRANSFERASE-RXN]]
-* [[RXN-8791]]
+* [[GGPS]]
+* [[RXN-3701]]
+* [[RXN-7658]]
+* [[RXN-7673]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=bacteriochlorophyll a}}
+{{#set: common-name=geranylgeranyl diphosphate}}
-{{#set: molecular-weight=910.51}}
+{{#set: inchi-key=inchikey=oinneunvozhbox-qircyjposa-k}}
+{{#set: molecular-weight=447.424}}