Difference between revisions of "GERANYLGERANYL-PP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=4.99.1.3-RXN 4.99.1.3-RXN] == * direction: ** left-to-right * common-name: ** sirohydrochlorin coba...")
(Created page with "Category:metabolite == Metabolite GERANYLGERANYL-PP == * common-name: ** geranylgeranyl diphosphate * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=4.99.1.3-RXN 4.99.1.3-RXN] ==
+
== Metabolite GERANYLGERANYL-PP ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** sirohydrochlorin cobaltochelatase
+
** geranylgeranyl diphosphate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/4.99.1.3 ec-4.99.1.3]
+
** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CO+2]][c] '''+''' 1 [[SIROHYDROCHLORIN]][c] '''=>''' 1 [[COBALT-SIROHYDROCHLORIN]][c] '''+''' 2 [[PROTON]][c]
+
** oinneunvozhbox-qircyjposa-k
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ19170]]
+
** 447.424
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[2.5.1.32-RXN]]
−
** Category: [[orthology]]
+
* [[2.5.1.41-RXN]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[2.5.1.42-RXN]]
−
== Pathway(s)  ==
+
* [[RXN-10625]]
−
* [[PWY-7377]], cob(II)yrinate a,c-diamide biosynthesis I (early cobalt insertion): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7377 PWY-7377]
+
* [[RXN-11486]]
−
** '''4''' reactions found over '''15''' reactions in the full pathway
+
* [[RXN-11488]]
−
== Reconstruction information  ==
+
* [[RXN-13323]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-14929]]
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-17480]]
−
== External links  ==
+
* [[RXN-3701]]
−
* RHEA:
+
* [[RXN-7658]]
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15893 15893]
+
* [[RXN-7663]]
−
* LIGAND-RXN:
+
* [[RXN-7673]]
−
** [http://www.genome.jp/dbget-bin/www_bget?R05807 R05807]
+
* [[RXN-8788]]
−
{{#set: direction=left-to-right}}
+
== Reaction(s) known to produce the compound ==
−
{{#set: common-name=sirohydrochlorin cobaltochelatase}}
+
* [[FARNESYLTRANSTRANSFERASE-RXN]]
−
{{#set: ec-number=ec-4.99.1.3}}
+
* [[GGPS]]
−
{{#set: nb gene associated=1}}
+
* [[RXN-3701]]
−
{{#set: nb pathway associated=1}}
+
* [[RXN-7658]]
−
{{#set: reconstruction category=annotation|orthology}}
+
* [[RXN-7673]]
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+
== Reaction(s) of unknown directionality ==
−
{{#set: reconstruction comment=n.a}}
+
{{#set: common-name=geranylgeranyl diphosphate}}
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
+
{{#set: inchi-key=inchikey=oinneunvozhbox-qircyjposa-k}}
 +
{{#set: molecular-weight=447.424}}

Latest revision as of 11:15, 18 March 2021

Metabolite GERANYLGERANYL-PP

  • common-name:
    • geranylgeranyl diphosphate
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
  • inchi-key:
    • oinneunvozhbox-qircyjposa-k
  • molecular-weight:
    • 447.424

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=GERANYLGERANYL-PP&oldid=138619"