Difference between revisions of "GERANYLGERANYL-PP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite RNASE-III-PROCESSING-PRODUCT-MRNA == * common-name: ** rnase iii processing product mrna == Reaction(s) known to consume the compound ==...")
(Created page with "Category:metabolite == Metabolite GERANYLGERANYL-PP == * common-name: ** geranylgeranyl diphosphate * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite RNASE-III-PROCESSING-PRODUCT-MRNA ==
+
== Metabolite GERANYLGERANYL-PP ==
 
* common-name:
 
* common-name:
** rnase iii processing product mrna
+
** geranylgeranyl diphosphate
 +
* smiles:
 +
** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
 +
* inchi-key:
 +
** oinneunvozhbox-qircyjposa-k
 +
* molecular-weight:
 +
** 447.424
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2.5.1.32-RXN]]
 +
* [[2.5.1.41-RXN]]
 +
* [[2.5.1.42-RXN]]
 +
* [[RXN-10625]]
 +
* [[RXN-11486]]
 +
* [[RXN-11488]]
 +
* [[RXN-13323]]
 +
* [[RXN-14929]]
 +
* [[RXN-17480]]
 +
* [[RXN-3701]]
 +
* [[RXN-7658]]
 +
* [[RXN-7663]]
 +
* [[RXN-7673]]
 +
* [[RXN-8788]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.1.26.3-RXN]]
+
* [[FARNESYLTRANSTRANSFERASE-RXN]]
 +
* [[GGPS]]
 +
* [[RXN-3701]]
 +
* [[RXN-7658]]
 +
* [[RXN-7673]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=rnase iii processing product mrna}}
+
{{#set: common-name=geranylgeranyl diphosphate}}
 +
{{#set: inchi-key=inchikey=oinneunvozhbox-qircyjposa-k}}
 +
{{#set: molecular-weight=447.424}}

Latest revision as of 11:15, 18 March 2021

Metabolite GERANYLGERANYL-PP

  • common-name:
    • geranylgeranyl diphosphate
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
  • inchi-key:
    • oinneunvozhbox-qircyjposa-k
  • molecular-weight:
    • 447.424

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality