Difference between revisions of "GERANYLGERANYL-PP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18204 RXN-18204] == * direction: ** reversible == Reaction formula == * 1 CPDQT-38[c] '''+'...")
(Created page with "Category:metabolite == Metabolite GERANYLGERANYL-PP == * common-name: ** geranylgeranyl diphosphate * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18204 RXN-18204] ==
+
== Metabolite GERANYLGERANYL-PP ==
−
* direction:
+
* common-name:
−
** reversible
+
** geranylgeranyl diphosphate
−
== Reaction formula ==
+
* smiles:
−
* 1 [[CPDQT-38]][c] '''+''' 1 [[NAD]][c] '''<=>''' 1 [[CPD-19489]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c]
+
** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
* Gene: [[SJ21291]]
+
** oinneunvozhbox-qircyjposa-k
−
** Category: [[annotation]]
+
* molecular-weight:
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
** 447.424
−
== Pathway(s) ==
+
== Reaction(s) known to consume the compound ==
−
* [[PWYQT-4450]], aliphatic glucosinolate biosynthesis, side chain elongation cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWYQT-4450 PWYQT-4450]
+
* [[2.5.1.32-RXN]]
−
** '''5''' reactions found over '''30''' reactions in the full pathway
+
* [[2.5.1.41-RXN]]
−
== Reconstruction information  ==
+
* [[2.5.1.42-RXN]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-10625]]
−
== External links  ==
+
* [[RXN-11486]]
−
{{#set: direction=reversible}}
+
* [[RXN-11488]]
−
{{#set: nb gene associated=1}}
+
* [[RXN-13323]]
−
{{#set: nb pathway associated=1}}
+
* [[RXN-14929]]
−
{{#set: reconstruction category=annotation}}
+
* [[RXN-17480]]
−
{{#set: reconstruction tool=pathwaytools}}
+
* [[RXN-3701]]
−
{{#set: reconstruction comment=n.a}}
+
* [[RXN-7658]]
−
{{#set: reconstruction source=saccharina_japonica_genome}}
+
* [[RXN-7663]]
 +
* [[RXN-7673]]
 +
* [[RXN-8788]]
 +
== Reaction(s) known to produce the compound ==
 +
* [[FARNESYLTRANSTRANSFERASE-RXN]]
 +
* [[GGPS]]
 +
* [[RXN-3701]]
 +
* [[RXN-7658]]
 +
* [[RXN-7673]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=geranylgeranyl diphosphate}}
 +
{{#set: inchi-key=inchikey=oinneunvozhbox-qircyjposa-k}}
 +
{{#set: molecular-weight=447.424}}

Latest revision as of 11:15, 18 March 2021

Metabolite GERANYLGERANYL-PP

  • common-name:
    • geranylgeranyl diphosphate
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
  • inchi-key:
    • oinneunvozhbox-qircyjposa-k
  • molecular-weight:
    • 447.424

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=GERANYLGERANYL-PP&oldid=138619"