Difference between revisions of "GLC"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.41-RXN 2.3.1.41-RXN] == * direction: ** reversible * common-name: ** 3-oxoacyl-[acyl-carrier-...")
 
(Created page with "Category:metabolite == Metabolite GLC == * common-name: ** β-d-glucopyranose * smiles: ** c(o)c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** wqzgkkkjijffok-vfuothlcsa-n * mol...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.41-RXN 2.3.1.41-RXN] ==
+
== Metabolite GLC ==
* direction:
 
** reversible
 
 
* common-name:
 
* common-name:
** 3-oxoacyl-[acyl-carrier-protein] synthase
+
** β-d-glucopyranose
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.3.1.179 ec-2.3.1.179]
+
** c(o)c1(oc(o)c(o)c(o)c(o)1)
** [http://enzyme.expasy.org/EC/2.3.1.41 ec-2.3.1.41]
+
* inchi-key:
== Reaction formula ==
+
** wqzgkkkjijffok-vfuothlcsa-n
* 1 [[ACYL-ACP]][c] '''+''' 1 [[MALONYL-ACP]][c] '''+''' 1 [[PROTON]][c] '''<=>''' 1 [[ACP]][c] '''+''' 1 [[B-KETOACYL-ACP]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
+
* molecular-weight:
== Gene(s) associated with this reaction  ==
+
** 180.157
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) known to consume the compound ==
* Gene: [[SJ18059]]
+
* [[ALDOSE-1-EPIMERASE-RXN]]
** Category: [[annotation]]
+
* [[GLUCISOM-RXN-GLC//CPD-15382.15.]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[biomass_rxn]]
* Gene: [[SJ06617]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
* [[3.2.1.106-RXN]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[ALDOSE-1-EPIMERASE-RXN]]
* Gene: [[SJ04443]]
+
* [[GLUCISOM-RXN-GLC//CPD-15382.15.]]
** Category: [[annotation]]
+
* [[TREHALA-RXN]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) of unknown directionality ==
** Category: [[orthology]]
+
{{#set: common-name=&beta;-d-glucopyranose}}
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: inchi-key=inchikey=wqzgkkkjijffok-vfuothlcsa-n}}
* Gene: [[SJ15983]]
+
{{#set: molecular-weight=180.157}}
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
** Category: [[orthology]]
 
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
* Gene: [[SJ10624]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ00005]]
 
** Category: [[orthology]]
 
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
* Gene: [[SJ15984]]
 
** Category: [[orthology]]
 
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
</div>
 
== Pathway(s) ==
 
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
== External links  ==
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R02768 R02768]
 
{{#set: direction=reversible}}
 
{{#set: common-name=3-oxoacyl-[acyl-carrier-protein] synthase}}
 
{{#set: ec-number=ec-2.3.1.41|ec-2.3.1.179}}
 
{{#set: nb gene associated=7}}
 
{{#set: nb pathway associated=0}}
 
{{#set: reconstruction category=orthology|annotation}}
 
{{#set: reconstruction tool=pathwaytools|pantograph}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite GLC

  • common-name:
    • β-d-glucopyranose
  • smiles:
    • c(o)c1(oc(o)c(o)c(o)c(o)1)
  • inchi-key:
    • wqzgkkkjijffok-vfuothlcsa-n
  • molecular-weight:
    • 180.157

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality