Difference between revisions of "GLC-1-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ04504 == * transcription-direction: ** negative * right-end-position: ** 420260 * left-end-position: ** 397738 * centisome-position: ** 77.96308...")
(Created page with "Category:metabolite == Metabolite GLC-1-P == * common-name: ** α-d-glucopyranose 1-phosphate * smiles: ** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1) * inchi-key: ** h...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ04504 ==
+
== Metabolite GLC-1-P ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** α-d-glucopyranose 1-phosphate
−
* right-end-position:
+
* smiles:
−
** 420260
+
** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
−
* left-end-position:
+
* inchi-key:
−
** 397738
+
** hxxfsfrbohsimq-vfuothlcsa-l
−
* centisome-position:
+
* molecular-weight:
−
** 77.96308   
+
** 258.121
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[GALACTURIDYLYLTRANS-RXN]]
−
== Reaction(s) associated ==
+
* [[GLUC1PURIDYLTRANS-RXN]]
−
* [[ATPASE-RXN]]
+
* [[PGCM]]
−
** Category: [[annotation]]
+
* [[PGMTh]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[PHOSPHOGLUCMUT-RXN]]
−
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
+
* [[RXN-12486]]
−
** Category: [[annotation]]
+
* [[RXN-16997]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN4FS-13]]
−
* [[RXN-12195]]
+
* [[UG1PUT]]
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[GALACTURIDYLYLTRANS-RXN]]
−
* [[RXN-12196]]
+
* [[GLUC1PURIDYLTRANS-RXN]]
−
** Category: [[annotation]]
+
* [[GLYCOPHOSPHORYL-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[GLYMALTOPHOSPHORYL-RXN]]
−
* [[RXN0-5462]]
+
* [[PGCM]]
−
** Category: [[annotation]]
+
* [[PGMTh]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[PHOSPHOGLUCMUT-RXN]]
−
== Pathway(s) associated ==
+
* [[RXN-12171]]
−
* [[PWY-7210]]
+
* [[RXN-12392]]
−
** '''8''' reactions found over '''8''' reactions in the full pathway
+
* [[RXN-12486]]
−
* [[PWY-7198]]
+
* [[RXN-14284]]
−
** '''6''' reactions found over '''7''' reactions in the full pathway
+
* [[RXN-14285]]
−
* [[PWY-7184]]
+
* [[RXN-14286]]
−
** '''9''' reactions found over '''9''' reactions in the full pathway
+
* [[RXN-14353]]
−
* [[PWY-6545]]
+
* [[RXN-1826]]
−
** '''8''' reactions found over '''9''' reactions in the full pathway
+
* [[RXN-9025]]
−
{{#set: transcription-direction=negative}}
+
* [[RXN0-5182]]
−
{{#set: right-end-position=420260}}
+
* [[RXN0-5184]]
−
{{#set: left-end-position=397738}}
+
== Reaction(s) of unknown directionality ==
−
{{#set: centisome-position=77.96308    }}
+
{{#set: common-name=α-d-glucopyranose 1-phosphate}}
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
{{#set: inchi-key=inchikey=hxxfsfrbohsimq-vfuothlcsa-l}}
−
{{#set: nb reaction associated=5}}
+
{{#set: molecular-weight=258.121}}
−
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite GLC-1-P

  • common-name:
    • α-d-glucopyranose 1-phosphate
  • smiles:
    • c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
  • inchi-key:
    • hxxfsfrbohsimq-vfuothlcsa-l
  • molecular-weight:
    • 258.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=GLC-1-P&oldid=138036"