Difference between revisions of "GLC-1-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18350 == * common-name: ** 1-palmitoyl-2-palmitoleoyl phosphatidate * smiles: ** cccccccccccccccc(occ(oc(=o)cccccccc=ccccccc)cop([o-]...")
(Created page with "Category:metabolite == Metabolite GLC-1-P == * common-name: ** α-d-glucopyranose 1-phosphate * smiles: ** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1) * inchi-key: ** h...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-18350 ==
+
== Metabolite GLC-1-P ==
 
* common-name:
 
* common-name:
** 1-palmitoyl-2-palmitoleoyl phosphatidate
+
** α-d-glucopyranose 1-phosphate
 
* smiles:
 
* smiles:
** cccccccccccccccc(occ(oc(=o)cccccccc=ccccccc)cop([o-])(=o)[o-])=o
+
** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
 
* inchi-key:
 
* inchi-key:
** scnlprdasxifjk-iqulndiksa-l
+
** hxxfsfrbohsimq-vfuothlcsa-l
 
* molecular-weight:
 
* molecular-weight:
** 644.867
+
** 258.121
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[GALACTURIDYLYLTRANS-RXN]]
 +
* [[GLUC1PURIDYLTRANS-RXN]]
 +
* [[PGCM]]
 +
* [[PGMTh]]
 +
* [[PHOSPHOGLUCMUT-RXN]]
 +
* [[RXN-12486]]
 +
* [[RXN-16997]]
 +
* [[RXN4FS-13]]
 +
* [[UG1PUT]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17008]]
+
* [[GALACTURIDYLYLTRANS-RXN]]
* [[RXN-17012]]
+
* [[GLUC1PURIDYLTRANS-RXN]]
 +
* [[GLYCOPHOSPHORYL-RXN]]
 +
* [[GLYMALTOPHOSPHORYL-RXN]]
 +
* [[PGCM]]
 +
* [[PGMTh]]
 +
* [[PHOSPHOGLUCMUT-RXN]]
 +
* [[RXN-12171]]
 +
* [[RXN-12392]]
 +
* [[RXN-12486]]
 +
* [[RXN-14284]]
 +
* [[RXN-14285]]
 +
* [[RXN-14286]]
 +
* [[RXN-14353]]
 +
* [[RXN-1826]]
 +
* [[RXN-9025]]
 +
* [[RXN0-5182]]
 +
* [[RXN0-5184]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-palmitoyl-2-palmitoleoyl phosphatidate}}
+
{{#set: common-name=α-d-glucopyranose 1-phosphate}}
{{#set: inchi-key=inchikey=scnlprdasxifjk-iqulndiksa-l}}
+
{{#set: inchi-key=inchikey=hxxfsfrbohsimq-vfuothlcsa-l}}
{{#set: molecular-weight=644.867}}
+
{{#set: molecular-weight=258.121}}

Latest revision as of 11:14, 18 March 2021

Metabolite GLC-1-P

  • common-name:
    • α-d-glucopyranose 1-phosphate
  • smiles:
    • c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
  • inchi-key:
    • hxxfsfrbohsimq-vfuothlcsa-l
  • molecular-weight:
    • 258.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality