Difference between revisions of "GLC-D-LACTONE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14550 RXN-14550] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/...") |
(Created page with "Category:metabolite == Metabolite GLC-D-LACTONE == * common-name: ** d-glucono-1,5-lactone * smiles: ** c(o)c1(oc(c(c(c1o)o)o)=o) * inchi-key: ** phoqvhqstubqqk-sqougzdysa...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite GLC-D-LACTONE == |
− | * | + | * common-name: |
− | ** | + | ** d-glucono-1,5-lactone |
− | * | + | * smiles: |
− | ** | + | ** c(o)c1(oc(c(c(c1o)o)o)=o) |
− | + | * inchi-key: | |
− | + | ** phoqvhqstubqqk-sqougzdysa-n | |
− | + | * molecular-weight: | |
− | * | + | ** 178.141 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | ** | + | * [[GLUCONOLACT-RXN]] |
− | == | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | {{#set: common-name=d-glucono-1,5-lactone}} |
− | == | + | {{#set: inchi-key=inchikey=phoqvhqstubqqk-sqougzdysa-n}} |
− | + | {{#set: molecular-weight=178.141}} | |
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite GLC-D-LACTONE
- common-name:
- d-glucono-1,5-lactone
- smiles:
- c(o)c1(oc(c(c(c1o)o)o)=o)
- inchi-key:
- phoqvhqstubqqk-sqougzdysa-n
- molecular-weight:
- 178.141