Difference between revisions of "GLC-D-LACTONE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Oxidized-NrdH-Proteins == * common-name: ** an oxidized nrdh glutaredoxin-like protein == Reaction(s) known to consume the compound == ==...") |
(Created page with "Category:metabolite == Metabolite GLC-D-LACTONE == * common-name: ** d-glucono-1,5-lactone * smiles: ** c(o)c1(oc(c(c(c1o)o)o)=o) * inchi-key: ** phoqvhqstubqqk-sqougzdysa...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite GLC-D-LACTONE == |
* common-name: | * common-name: | ||
| − | ** | + | ** d-glucono-1,5-lactone |
| + | * smiles: | ||
| + | ** c(o)c1(oc(c(c(c1o)o)o)=o) | ||
| + | * inchi-key: | ||
| + | ** phoqvhqstubqqk-sqougzdysa-n | ||
| + | * molecular-weight: | ||
| + | ** 178.141 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[GLUCONOLACT-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-glucono-1,5-lactone}} |
| + | {{#set: inchi-key=inchikey=phoqvhqstubqqk-sqougzdysa-n}} | ||
| + | {{#set: molecular-weight=178.141}} | ||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite GLC-D-LACTONE
- common-name:
- d-glucono-1,5-lactone
- smiles:
- c(o)c1(oc(c(c(c1o)o)o)=o)
- inchi-key:
- phoqvhqstubqqk-sqougzdysa-n
- molecular-weight:
- 178.141
