Difference between revisions of "GLN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ00147 == * transcription-direction: ** positive * right-end-position: ** 71270 * left-end-position: ** 60170 * centisome-position: ** 35.11649...")
(Created page with "Category:metabolite == Metabolite GLN == * common-name: ** l-glutamine * smiles: ** c(=o)(n)ccc([n+])c([o-])=o * inchi-key: ** zdxpyrjpndtmrx-vkhmyheasa-n * molecular-weig...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ00147 ==
+
== Metabolite GLN ==
* transcription-direction:
+
* common-name:
** positive
+
** l-glutamine
* right-end-position:
+
* smiles:
** 71270
+
** c(=o)(n)ccc([n+])c([o-])=o
* left-end-position:
+
* inchi-key:
** 60170
+
** zdxpyrjpndtmrx-vkhmyheasa-n
* centisome-position:
+
* molecular-weight:
** 35.11649   
+
** 146.146
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_sterols_curated]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
== Reaction(s) associated ==
+
* [[2.6.1.64-RXN]]
* [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
+
* [[6.3.5.6-RXN]]
** Category: [[annotation]]
+
* [[6.3.5.7-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[ANTHRANSYN-RXN]]
{{#set: transcription-direction=positive}}
+
* [[ASNSYNB-RXN]]
{{#set: right-end-position=71270}}
+
* [[CARBPSYN-RXN]]
{{#set: left-end-position=60170}}
+
* [[CTPSYN-RXN]]
{{#set: centisome-position=35.11649    }}
+
* [[FGAMSYN-RXN]]
{{#set: organism associated=S.japonica_sterols_curated}}
+
* [[GLUTAMATE-SYNTHASE-FERREDOXIN-RXN]]
{{#set: nb reaction associated=1}}
+
* [[GLUTAMATE-SYNTHASE-NADH-RXN]]
 +
* [[GLUTAMATESYN-RXN]]
 +
* [[GLUTAMIDOTRANS-RXN]]
 +
* [[GLUTAMIN-RXN]]
 +
* [[GLUTAMINE--TRNA-LIGASE-RXN]]
 +
* [[GMP-SYN-GLUT-RXN]]
 +
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
 +
* [[NAD-SYNTH-GLN-RXN]]
 +
* [[PABASYN-RXN]]
 +
* [[PRPPAMIDOTRANS-RXN]]
 +
* [[RXN-11322]]
 +
* [[biomass_rxn]]
 +
</div>
 +
== Reaction(s) known to produce the compound ==
 +
* [[2.6.1.64-RXN]]
 +
* [[ANTHRANSYN-RXN]]
 +
* [[GLUTAMINESYN-RXN]]
 +
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
 +
* [[PABASYN-RXN]]
 +
* [[PRPPAMIDOTRANS-RXN]]
 +
* [[RXN0-6976]]
 +
* [[RXN0-6983]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=l-glutamine}}
 +
{{#set: inchi-key=inchikey=zdxpyrjpndtmrx-vkhmyheasa-n}}
 +
{{#set: molecular-weight=146.146}}

Latest revision as of 11:10, 18 March 2021