Difference between revisions of "GLN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ14916 == * transcription-direction: ** positive * right-end-position: ** 192746 * left-end-position: ** 188893 * centisome-position: ** 61.996567...")
(Created page with "Category:metabolite == Metabolite GLN == * common-name: ** l-glutamine * smiles: ** c(=o)(n)ccc([n+])c([o-])=o * inchi-key: ** zdxpyrjpndtmrx-vkhmyheasa-n * molecular-weig...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ14916 ==
+
== Metabolite GLN ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** l-glutamine
−
* right-end-position:
+
* smiles:
−
** 192746
+
** c(=o)(n)ccc([n+])c([o-])=o
−
* left-end-position:
+
* inchi-key:
−
** 188893
+
** zdxpyrjpndtmrx-vkhmyheasa-n
−
* centisome-position:
+
* molecular-weight:
−
** 61.996567   
+
** 146.146
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
 
−
== Reaction(s) associated ==
 
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
−
* [[3PGAREARR-RXN]]
+
* [[2.6.1.64-RXN]]
−
** Category: [[annotation]]
+
* [[6.3.5.6-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[6.3.5.7-RXN]]
−
** Category: [[orthology]]
+
* [[ANTHRANSYN-RXN]]
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
* [[ASNSYNB-RXN]]
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
* [[CARBPSYN-RXN]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[CTPSYN-RXN]]
−
* [[RXN-15509]]
+
* [[FGAMSYN-RXN]]
−
** Category: [[annotation]]
+
* [[GLUTAMATE-SYNTHASE-FERREDOXIN-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[GLUTAMATE-SYNTHASE-NADH-RXN]]
−
* [[RXN-15510]]
+
* [[GLUTAMATESYN-RXN]]
−
** Category: [[annotation]]
+
* [[GLUTAMIDOTRANS-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[GLUTAMIN-RXN]]
−
* [[RXN-15511]]
+
* [[GLUTAMINE--TRNA-LIGASE-RXN]]
−
** Category: [[annotation]]
+
* [[GMP-SYN-GLUT-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
−
* [[RXN-15512]]
+
* [[NAD-SYNTH-GLN-RXN]]
−
** Category: [[annotation]]
+
* [[PABASYN-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[PRPPAMIDOTRANS-RXN]]
−
* [[RXN-15513]]
+
* [[RXN-11322]]
−
** Category: [[annotation]]
+
* [[biomass_rxn]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
 
</div>
 
</div>
−
== Pathway(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[2.6.1.64-RXN]]
−
* [[PWY-6142]]
+
* [[ANTHRANSYN-RXN]]
−
** '''10''' reactions found over '''13''' reactions in the full pathway
+
* [[GLUTAMINESYN-RXN]]
−
* [[PWY-7003]]
+
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
−
** '''8''' reactions found over '''6''' reactions in the full pathway
+
* [[PABASYN-RXN]]
−
* [[PWY-7218]]
+
* [[PRPPAMIDOTRANS-RXN]]
−
** '''7''' reactions found over '''4''' reactions in the full pathway
+
* [[RXN0-6976]]
−
* [[GLYCOLYSIS]]
+
* [[RXN0-6983]]
−
** '''11''' reactions found over '''12''' reactions in the full pathway
+
== Reaction(s) of unknown directionality ==
−
* [[P341-PWY]]
+
{{#set: common-name=l-glutamine}}
−
** '''6''' reactions found over '''10''' reactions in the full pathway
+
{{#set: inchi-key=inchikey=zdxpyrjpndtmrx-vkhmyheasa-n}}
−
* [[PWY-5723]]
+
{{#set: molecular-weight=146.146}}
−
** '''10''' reactions found over '''10''' reactions in the full pathway
 
−
* [[P124-PWY]]
 
−
** '''12''' reactions found over '''15''' reactions in the full pathway
 
−
* [[PWY-2221]]
 
−
** '''6''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-5484]]
 
−
** '''10''' reactions found over '''11''' reactions in the full pathway
 
−
* [[PWY-1042]]
 
−
** '''9''' reactions found over '''10''' reactions in the full pathway
 
−
* [[PWY-6886]]
 
−
** '''8''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-6901]]
 
−
** '''10''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-7124]]
 
−
** '''8''' reactions found over '''8''' reactions in the full pathway
 
−
* [[GLUCONEO-PWY]]
 
−
** '''12''' reactions found over '''13''' reactions in the full pathway
 
−
* [[PWY-6405]]
 
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-1622]]
 
−
** '''6''' reactions found over '''13''' reactions in the full pathway
 
−
* [[ANAGLYCOLYSIS-PWY]]
 
−
** '''10''' reactions found over '''11''' reactions in the full pathway
 
−
* [[PWY66-399]]
 
−
** '''11''' reactions found over '''12''' reactions in the full pathway
 
−
* [[P122-PWY]]
 
−
** '''16''' reactions found over '''18''' reactions in the full pathway
 
−
</div>
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=192746}}
 
−
{{#set: left-end-position=188893}}
 
−
{{#set: centisome-position=61.996567    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=6}}
 
−
{{#set: nb pathway associated=19}}
 

Latest revision as of 11:10, 18 March 2021

Metabolite GLN

  • common-name:
    • l-glutamine
  • smiles:
    • c(=o)(n)ccc([n+])c([o-])=o
  • inchi-key:
    • zdxpyrjpndtmrx-vkhmyheasa-n
  • molecular-weight:
    • 146.146

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=GLN&oldid=136577"