Difference between revisions of "GLN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ19669 == * transcription-direction: ** negative * right-end-position: ** 369144 * left-end-position: ** 350818 * centisome-position: ** 55.55955...")
(Created page with "Category:metabolite == Metabolite GLN == * common-name: ** l-glutamine * smiles: ** c(=o)(n)ccc([n+])c([o-])=o * inchi-key: ** zdxpyrjpndtmrx-vkhmyheasa-n * molecular-weig...")
 
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ19669 ==
+
== Metabolite GLN ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** l-glutamine
−
* right-end-position:
+
* smiles:
−
** 369144
+
** c(=o)(n)ccc([n+])c([o-])=o
−
* left-end-position:
+
* inchi-key:
−
** 350818
+
** zdxpyrjpndtmrx-vkhmyheasa-n
−
* centisome-position:
+
* molecular-weight:
−
** 55.55955   
+
** 146.146
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
 
−
== Reaction(s) associated ==
 
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
−
* [[ACOAD1f]]
+
* [[2.6.1.64-RXN]]
−
** Category: [[orthology]]
+
* [[6.3.5.6-RXN]]
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
* [[6.3.5.7-RXN]]
−
* [[ACYL-COA-OXIDASE-RXN]]
+
* [[ANTHRANSYN-RXN]]
−
** Category: [[orthology]]
+
* [[ASNSYNB-RXN]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[CARBPSYN-RXN]]
−
* [[ACYLCOADEHYDROG-RXN]]
+
* [[CTPSYN-RXN]]
−
** Category: [[annotation]]
+
* [[FGAMSYN-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[GLUTAMATE-SYNTHASE-FERREDOXIN-RXN]]
−
** Category: [[orthology]]
+
* [[GLUTAMATE-SYNTHASE-NADH-RXN]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[GLUTAMATESYN-RXN]]
−
* [[BUTYRYL-COA-DEHYDROGENASE-RXN]]
+
* [[GLUTAMIDOTRANS-RXN]]
−
** Category: [[annotation]]
+
* [[GLUTAMIN-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[GLUTAMINE--TRNA-LIGASE-RXN]]
−
* [[LONG-CHAIN-FATTY-ACYL-COA-REDUCTASE-RXN]]
+
* [[GMP-SYN-GLUT-RXN]]
−
** Category: [[annotation]]
+
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[NAD-SYNTH-GLN-RXN]]
−
** Category: [[orthology]]
+
* [[PABASYN-RXN]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[PRPPAMIDOTRANS-RXN]]
−
* [[RXN-10696]]
+
* [[RXN-11322]]
−
** Category: [[orthology]]
+
* [[biomass_rxn]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-10706]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-10707]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-11026]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-12518]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-12669]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-13449]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-14264]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-14576]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-14771]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-14775]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-14785]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-14789]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-14796]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-16134]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-17113]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
 
</div>
 
</div>
−
== Pathway(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[2.6.1.64-RXN]]
−
* [[FAO-PWY]]
+
* [[ANTHRANSYN-RXN]]
−
** '''6''' reactions found over '''7''' reactions in the full pathway
+
* [[GLUTAMINESYN-RXN]]
−
* [[PWY-6583]]
+
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
−
** '''6''' reactions found over '''8''' reactions in the full pathway
+
* [[PABASYN-RXN]]
−
* [[P163-PWY]]
+
* [[PRPPAMIDOTRANS-RXN]]
−
** '''3''' reactions found over '''10''' reactions in the full pathway
+
* [[RXN0-6976]]
−
* [[PWY-5022]]
+
* [[RXN0-6983]]
−
** '''3''' reactions found over '''7''' reactions in the full pathway
+
== Reaction(s) of unknown directionality ==
−
* [[PWY-5676]]
+
{{#set: common-name=l-glutamine}}
−
** '''4''' reactions found over '''5''' reactions in the full pathway
+
{{#set: inchi-key=inchikey=zdxpyrjpndtmrx-vkhmyheasa-n}}
−
* [[PWY-5677]]
+
{{#set: molecular-weight=146.146}}
−
** '''1''' reactions found over '''7''' reactions in the full pathway
 
−
* [[CENTFERM-PWY]]
 
−
** '''5''' reactions found over '''7''' reactions in the full pathway
 
−
* [[P162-PWY]]
 
−
** '''7''' reactions found over '''10''' reactions in the full pathway
 
−
* [[P3-PWY]]
 
−
** '''3''' reactions found over '''11''' reactions in the full pathway
 
−
* [[PWY-735]]
 
−
** '''16''' reactions found over '''19''' reactions in the full pathway
 
−
* [[PWY-7007]]
 
−
** '''4''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY-7288]]
 
−
** '''4''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-5136]]
 
−
** '''5''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY66-391]]
 
−
** '''6''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-6837]]
 
−
** '''4''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-6920]]
 
−
** '''5''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY-7291]]
 
−
** '''2''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-7337]]
 
−
** '''6''' reactions found over '''12''' reactions in the full pathway
 
−
* [[PWY-7338]]
 
−
** '''6''' reactions found over '''12''' reactions in the full pathway
 
−
* [[PWY-7340]]
 
−
** '''5''' reactions found over '''10''' reactions in the full pathway
 
−
* [[PWY-7606]]
 
−
** '''8''' reactions found over '''14''' reactions in the full pathway
 
−
* [[PWY-7726]]
 
−
** '''8''' reactions found over '''13''' reactions in the full pathway
 
−
</div>
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=369144}}
 
−
{{#set: left-end-position=350818}}
 
−
{{#set: centisome-position=55.55955    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=21}}
 
−
{{#set: nb pathway associated=22}}
 

Latest revision as of 11:10, 18 March 2021

Metabolite GLN

  • common-name:
    • l-glutamine
  • smiles:
    • c(=o)(n)ccc([n+])c([o-])=o
  • inchi-key:
    • zdxpyrjpndtmrx-vkhmyheasa-n
  • molecular-weight:
    • 146.146

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=GLN&oldid=136577"