Difference between revisions of "GLT"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ01225 == * transcription-direction: ** positive * right-end-position: ** 449155 * left-end-position: ** 434760 * centisome-position: ** 78.563324...")
 
(Created page with "Category:metabolite == Metabolite GLT == * common-name: ** l-glutamate * smiles: ** c(ccc(c(=o)[o-])[n+])([o-])=o * inchi-key: ** whuutdbjxjrkmk-vkhmyheasa-m * molecular-w...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ01225 ==
+
== Metabolite GLT ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** l-glutamate
−
* right-end-position:
+
* smiles:
−
** 449155
+
** c(ccc(c(=o)[o-])[n+])([o-])=o
−
* left-end-position:
+
* inchi-key:
−
** 434760
+
** whuutdbjxjrkmk-vkhmyheasa-m
−
* centisome-position:
+
* molecular-weight:
−
** 78.563324   
+
** 146.122
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
−
== Reaction(s) associated ==
+
* [[2.6.1.57-RXN]]
−
* [[QUERCETIN-23-DIOXYGENASE-RXN]]
+
* [[2.6.1.7-RXN]]
−
** Category: [[annotation]]
+
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[6.1.1.24-RXN]]
−
== Pathway(s) associated ==
+
* [[ACETYLORNTRANSAM-RXN]]
−
* [[PWY-6848]]
+
* [[ALANINE-AMINOTRANSFERASE-RXN]]
−
** '''1''' reactions found over '''3''' reactions in the full pathway
+
* [[ANTHRANSYN-RXN]]
−
{{#set: transcription-direction=positive}}
+
* [[ASPAMINOTRANS-RXN]]
−
{{#set: right-end-position=449155}}
+
* [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]]
−
{{#set: left-end-position=434760}}
+
* [[BRANCHED-CHAINAMINOTRANSFERLEU-RXN]]
−
{{#set: centisome-position=78.563324    }}
+
* [[BRANCHED-CHAINAMINOTRANSFERVAL-RXN]]
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* [[CYSTEINE-AMINOTRANSFERASE-RXN]]
−
{{#set: nb reaction associated=1}}
+
* [[DIHYDROFOLATESYNTH-RXN]]
−
{{#set: nb pathway associated=1}}
+
* [[FOLYLPOLYGLUTAMATESYNTH-RXN]]
 +
* [[FORMYLTHFGLUSYNTH-RXN]]
 +
* [[GABATRANSAM-RXN]]
 +
* [[GLURS-RXN]]
 +
* [[GLUTAMATE-DEHYDROGENASE-RXN]]
 +
* [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]]
 +
* [[GLUTAMINESYN-RXN]]
 +
* [[GLUTCYSLIG-RXN]]
 +
* [[GLUTDECARBOX-RXN]]
 +
* [[GLUTDEHYD-RXN]]
 +
* [[GLUTKIN-RXN]]
 +
* [[GLYCINE-AMINOTRANSFERASE-RXN]]
 +
* [[HISTAMINOTRANS-RXN]]
 +
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
 +
* [[N-ACETYLTRANSFER-RXN]]
 +
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
 +
* [[PABASYN-RXN]]
 +
* [[PHEAMINOTRANS-RXN]]
 +
* [[PREPHENATE-TRANSAMINE-RXN]]
 +
* [[PRPPAMIDOTRANS-RXN]]
 +
* [[PSERTRANSAM-RXN]]
 +
* [[PSERTRANSAMPYR-RXN]]
 +
* [[RXN-10721]]
 +
* [[RXN-10814]]
 +
* [[RXN-11737]]
 +
* [[RXN-12878]]
 +
* [[RXN-13697]]
 +
* [[RXN-13698]]
 +
* [[RXN-14147]]
 +
* [[RXN-15007]]
 +
* [[RXN-2901]]
 +
* [[RXN-6341]]
 +
* [[RXN-7737]]
 +
* [[RXN-9386]]
 +
* [[RXN0-1863]]
 +
* [[RXN0-2921]]
 +
* [[SUCCINYLDIAMINOPIMTRANS-RXN]]
 +
* [[TRANS-RXN-261]]
 +
* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
 +
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
 +
* [[biomass_rxn]]
 +
</div>
 +
== Reaction(s) known to produce the compound ==
 +
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[1.5.1.9-RXN]]
 +
* [[2.6.1.57-RXN]]
 +
* [[2.6.1.7-RXN]]
 +
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
 +
* [[3.4.17.21-RXN]]
 +
* [[5-OXOPROLINASE-ATP-HYDROLYSING-RXN]]
 +
* [[6.3.5.6-RXN]]
 +
* [[6.3.5.7-RXN]]
 +
* [[ACETYLORNTRANSAM-RXN]]
 +
* [[ALANINE-AMINOTRANSFERASE-RXN]]
 +
* [[ANTHRANSYN-RXN]]
 +
* [[ASNSYNB-RXN]]
 +
* [[ASPAMINOTRANS-RXN]]
 +
* [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]]
 +
* [[BRANCHED-CHAINAMINOTRANSFERLEU-RXN]]
 +
* [[BRANCHED-CHAINAMINOTRANSFERVAL-RXN]]
 +
* [[CARBPSYN-RXN]]
 +
* [[CTPSYN-RXN]]
 +
* [[CYSTEINE-AMINOTRANSFERASE-RXN]]
 +
* [[FGAMSYN-RXN]]
 +
* [[GABATRANSAM-RXN]]
 +
* [[GLUTAMATE-DEHYDROGENASE-RXN]]
 +
* [[GLUTAMATE-FORMIMINOTRANSFERASE-RXN]]
 +
* [[GLUTAMATE-SYNTHASE-FERREDOXIN-RXN]]
 +
* [[GLUTAMATE-SYNTHASE-NADH-RXN]]
 +
* [[GLUTAMATESYN-RXN]]
 +
* [[GLUTAMIDOTRANS-RXN]]
 +
* [[GLUTAMIN-RXN]]
 +
* [[GLUTDEHYD-RXN]]
 +
* [[GLYCINE-AMINOTRANSFERASE-RXN]]
 +
* [[GMP-SYN-GLUT-RXN]]
 +
* [[HISTAMINOTRANS-RXN]]
 +
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
 +
* [[N-ACETYLTRANSFER-RXN]]
 +
* [[NAD-SYNTH-GLN-RXN]]
 +
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
 +
* [[PABASYN-RXN]]
 +
* [[PHEAMINOTRANS-RXN]]
 +
* [[PREPHENATE-TRANSAMINE-RXN]]
 +
* [[PRPPAMIDOTRANS-RXN]]
 +
* [[PSERTRANSAM-RXN]]
 +
* [[PSERTRANSAMPYR-RXN]]
 +
* [[PYRROLINECARBDEHYDROG-RXN]]
 +
* [[RXN-10721]]
 +
* [[RXN-10814]]
 +
* [[RXN-11322]]
 +
* [[RXN-11737]]
 +
* [[RXN-12618]]
 +
* [[RXN-13675]]
 +
* [[RXN-13697]]
 +
* [[RXN-13698]]
 +
* [[RXN-14116]]
 +
* [[RXN-14147]]
 +
* [[RXN-15007]]
 +
* [[RXN-2901]]
 +
* [[RXN-3741]]
 +
* [[RXN-6641]]
 +
* [[RXN-7737]]
 +
* [[RXN0-1863]]
 +
* [[RXN0-6981]]
 +
* [[RXN0-6984]]
 +
* [[SUCCINYLDIAMINOPIMTRANS-RXN]]
 +
* [[TRANS-RXN-261]]
 +
* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
 +
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
 +
</div>
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=l-glutamate}}
 +
{{#set: inchi-key=inchikey=whuutdbjxjrkmk-vkhmyheasa-m}}
 +
{{#set: molecular-weight=146.122}}

Latest revision as of 11:14, 18 March 2021

Metabolite GLT

  • common-name:
    • l-glutamate
  • smiles:
    • c(ccc(c(=o)[o-])[n+])([o-])=o
  • inchi-key:
    • whuutdbjxjrkmk-vkhmyheasa-m
  • molecular-weight:
    • 146.122

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=GLT&oldid=138009"