Difference between revisions of "GLT"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12565 == * common-name: ** n-acetyl-d-galactosamine 6-o-sulfate * smiles: ** cc(=o)nc1(c(o)oc(cos(=o)(=o)[o-])c(o)c(o)1) * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite CPD1F-96 == * common-name: ** gibberellin a19 * smiles: ** c=c1(c2(o)(cc3(c1)(c([ch]4(c(c)(cccc(c=o)([ch](cc2)3)4)c([o-])=o))c([o-])=o)))...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD1F-96 == |
* common-name: | * common-name: | ||
| − | ** | + | ** gibberellin a19 |
* smiles: | * smiles: | ||
| − | ** | + | ** c=c1(c2(o)(cc3(c1)(c([ch]4(c(c)(cccc(c=o)([ch](cc2)3)4)c([o-])=o))c([o-])=o))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** vncqcpqamdqeby-ytjhipewsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 360.406 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN1F-168]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=gibberellin a19}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vncqcpqamdqeby-ytjhipewsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=360.406}} |
Revision as of 18:55, 14 January 2021
Contents
Metabolite CPD1F-96
- common-name:
- gibberellin a19
- smiles:
- c=c1(c2(o)(cc3(c1)(c([ch]4(c(c)(cccc(c=o)([ch](cc2)3)4)c([o-])=o))c([o-])=o)))
- inchi-key:
- vncqcpqamdqeby-ytjhipewsa-l
- molecular-weight:
- 360.406
