Difference between revisions of "GLUCONATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-782 == * common-name: ** 3,4-dihydroxyphenylacetate * smiles: ** c([o-])(=o)cc1(c=cc(=c(c=1)o)o) * inchi-key: ** cffzdzcdufsofz-uhfff...") |
(Created page with "Category:metabolite == Metabolite 3-Phosphopolynucleotides == * common-name: ** a 3'-phosphopolynucleotide == Reaction(s) known to consume the compound == * POLYNUCLEOTI...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-Phosphopolynucleotides == |
* common-name: | * common-name: | ||
| − | ** 3 | + | ** a 3'-phosphopolynucleotide |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[POLYNUCLEOTIDE-3-PHOSPHATASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=3 | + | {{#set: common-name=a 3'-phosphopolynucleotide}} |
| − | |||
| − | |||
Revision as of 11:19, 15 January 2021
Contents
Metabolite 3-Phosphopolynucleotides
- common-name:
- a 3'-phosphopolynucleotide
