Difference between revisions of "GLUCONATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-Phosphopolynucleotides == * common-name: ** a 3'-phosphopolynucleotide == Reaction(s) known to consume the compound == * POLYNUCLEOTI...")
(Created page with "Category:metabolite == Metabolite GLUCONATE == * common-name: ** d-gluconate * smiles: ** c(o)c(o)c(o)c(o)c(o)c(=o)[o-] * inchi-key: ** rghnjxzeokukbd-sqougzdysa-m * molec...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-Phosphopolynucleotides ==
+
== Metabolite GLUCONATE ==
 
* common-name:
 
* common-name:
** a 3'-phosphopolynucleotide
+
** d-gluconate
 +
* smiles:
 +
** c(o)c(o)c(o)c(o)c(o)c(=o)[o-]
 +
* inchi-key:
 +
** rghnjxzeokukbd-sqougzdysa-m
 +
* molecular-weight:
 +
** 195.149
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[POLYNUCLEOTIDE-3-PHOSPHATASE-RXN]]
+
* [[GLUCONOKIN-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[GLUCONATE-5-DEHYDROGENASE-RXN]]
 +
* [[GLUCONOLACT-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 3'-phosphopolynucleotide}}
+
{{#set: common-name=d-gluconate}}
 +
{{#set: inchi-key=inchikey=rghnjxzeokukbd-sqougzdysa-m}}
 +
{{#set: molecular-weight=195.149}}

Latest revision as of 11:18, 18 March 2021

Metabolite GLUCONATE

  • common-name:
    • d-gluconate
  • smiles:
    • c(o)c(o)c(o)c(o)c(o)c(=o)[o-]
  • inchi-key:
    • rghnjxzeokukbd-sqougzdysa-m
  • molecular-weight:
    • 195.149

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality