Difference between revisions of "GLUCONATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-318 == * common-name: ** monodehydroascorbate radical * smiles: ** c(o)c(o)[ch]1(c(o)=c(o)c(=o)o1) * inchi-key: ** lhfjobmtajjotb-jla...") |
(Created page with "Category:metabolite == Metabolite GLUCONATE == * common-name: ** d-gluconate * smiles: ** c(o)c(o)c(o)c(o)c(o)c(=o)[o-] * inchi-key: ** rghnjxzeokukbd-sqougzdysa-m * molec...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite GLUCONATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** d-gluconate |
* smiles: | * smiles: | ||
| − | ** c(o)c(o) | + | ** c(o)c(o)c(o)c(o)c(o)c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** rghnjxzeokukbd-sqougzdysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 195.149 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[GLUCONOKIN-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[GLUCONATE-5-DEHYDROGENASE-RXN]] |
| − | * [[RXN | + | * [[GLUCONOLACT-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-gluconate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rghnjxzeokukbd-sqougzdysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=195.149}} |
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite GLUCONATE
- common-name:
- d-gluconate
- smiles:
- c(o)c(o)c(o)c(o)c(o)c(=o)[o-]
- inchi-key:
- rghnjxzeokukbd-sqougzdysa-m
- molecular-weight:
- 195.149
