Difference between revisions of "GLUCONATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-Phosphopolynucleotides == * common-name: ** a 3'-phosphopolynucleotide == Reaction(s) known to consume the compound == * POLYNUCLEOTI...") |
(Created page with "Category:metabolite == Metabolite CPD-7733 == * common-name: ** aurachin c * smiles: ** cc(c)=cccc(c)=cccc(c)=ccc2(c(c1(c=cc=cc=1n(c(c)=2)o))=o) * inchi-key: ** fihxchbehl...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-7733 == |
* common-name: | * common-name: | ||
− | ** | + | ** aurachin c |
+ | * smiles: | ||
+ | ** cc(c)=cccc(c)=cccc(c)=ccc2(c(c1(c=cc=cc=1n(c(c)=2)o))=o) | ||
+ | * inchi-key: | ||
+ | ** fihxchbehlcxeg-yefhwucqsa-n | ||
+ | * molecular-weight: | ||
+ | ** 379.541 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-15029]] |
+ | * [[RXN-17335]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=aurachin c}} |
+ | {{#set: inchi-key=inchikey=fihxchbehlcxeg-yefhwucqsa-n}} | ||
+ | {{#set: molecular-weight=379.541}} |
Revision as of 15:30, 5 January 2021
Contents
Metabolite CPD-7733
- common-name:
- aurachin c
- smiles:
- cc(c)=cccc(c)=cccc(c)=ccc2(c(c1(c=cc=cc=1n(c(c)=2)o))=o)
- inchi-key:
- fihxchbehlcxeg-yefhwucqsa-n
- molecular-weight:
- 379.541