Difference between revisions of "GLUCOSAMINE-1P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14485 == * common-name: ** glycyrrhetaldehyde * smiles: ** cc4(c)(c3(ccc2(c)(c1(c)(ccc5([ch](c1=cc(c2c(c)3ccc(o)4)=o)cc([ch]=o)(c)cc5...") |
(Created page with "Category:metabolite == Metabolite GLUCOSAMINE-1P == * common-name: ** d-glucosamine 1-phosphate * smiles: ** c(o)c1(oc(op(=o)([o-])[o-])c([n+])c(o)c(o)1) * inchi-key: ** y...") |
||
(2 intermediate revisions by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite GLUCOSAMINE-1P == |
* common-name: | * common-name: | ||
− | ** | + | ** d-glucosamine 1-phosphate |
* smiles: | * smiles: | ||
− | ** | + | ** c(o)c1(oc(op(=o)([o-])[o-])c([n+])c(o)c(o)1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ymjbyrvfgyxulk-qzabapfnsa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 258.144 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[2.3.1.157-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=d-glucosamine 1-phosphate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ymjbyrvfgyxulk-qzabapfnsa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=258.144}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite GLUCOSAMINE-1P
- common-name:
- d-glucosamine 1-phosphate
- smiles:
- c(o)c1(oc(op(=o)([o-])[o-])c([n+])c(o)c(o)1)
- inchi-key:
- ymjbyrvfgyxulk-qzabapfnsa-m
- molecular-weight:
- 258.144