Difference between revisions of "GLUCOSAMINYL-14-ETCETERA-MANNOSYL-R"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-734 == * common-name: ** (-)-jasmonate * smiles: ** ccc=ccc1(c(=o)ccc1cc([o-])=o) * inchi-key: ** znjfbwydhiglcu-hwkxxfmvsa-m * molec...")
(Created page with "Category:metabolite == Metabolite GLUCOSAMINYL-14-ETCETERA-MANNOSYL-R == * common-name: ** n-acetyl-β-d-glucosaminyl-1,4-(n-acetyl-d-glucosaminyl-1,2)-α-d-manno...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-734 ==
+
== Metabolite GLUCOSAMINYL-14-ETCETERA-MANNOSYL-R ==
 
* common-name:
 
* common-name:
** (-)-jasmonate
+
** n-acetyl-β-d-glucosaminyl-1,4-(n-acetyl-d-glucosaminyl-1,2)-α-d-mannosyl-1,3-(β-n-acetyl-d-glucosaminyl-1,2-α-d-mannosyl-1,6)-β-d-mannosyl-r
* smiles:
 
** ccc=ccc1(c(=o)ccc1cc([o-])=o)
 
* inchi-key:
 
** znjfbwydhiglcu-hwkxxfmvsa-m
 
* molecular-weight:
 
** 209.264
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-7873]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10767]]
+
* [[RXN-7873]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(-)-jasmonate}}
+
{{#set: common-name=n-acetyl-β-d-glucosaminyl-1,4-(n-acetyl-d-glucosaminyl-1,2)-α-d-mannosyl-1,3-(β-n-acetyl-d-glucosaminyl-1,2-α-d-mannosyl-1,6)-β-d-mannosyl-r}}
{{#set: inchi-key=inchikey=znjfbwydhiglcu-hwkxxfmvsa-m}}
 
{{#set: molecular-weight=209.264}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite GLUCOSAMINYL-14-ETCETERA-MANNOSYL-R

  • common-name:
    • n-acetyl-β-d-glucosaminyl-1,4-(n-acetyl-d-glucosaminyl-1,2)-α-d-mannosyl-1,3-(β-n-acetyl-d-glucosaminyl-1,2-α-d-mannosyl-1,6)-β-d-mannosyl-r

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality